≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Desiccated Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCCCCCCC(=O)SCCC[Si](OCC)(OCC)OCC |
|---|---|
| IUPAC Name | S-(3-triethoxysilylpropyl) octanethioate |
| InChIKey | JPPLPDOXWBVPCW-UHFFFAOYSA-N |
| INCHI | 1S/C17H36O4SSi/c1-5-9-10-11-12-14-17(18)22-15-13-16-23(19-6-2,20-7-3)21-8-4/h5-16H2,1-4H3 |
| Isómeros SMILES | CCCCCCCC(=O)SCCC[Si](OCC)(OCC)OCC |
| PubChem CID | 12135713 |
| Peso molecular | 364.62 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Clase | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Alkoxysilanes |
| Direct Parent | Trialkoxysilanes |
| Alternative Parents | Fatty acyl thioesters Thioesters Silyl ethers Carbothioic S-esters Sulfenyl compounds Organoheterosilanes Organic metalloid salts Carboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trialkoxysilane - Fatty acyl thioester - Thiocarboxylic acid ester - Silyl ether - Carbothioic s-ester - Carboxylic acid derivative - Thiocarboxylic acid or derivatives - Organoheterosilane - Sulfenyl compound - Organic metalloid salt - Organic oxygen compound - Carbonyl group - Organooxygen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as trialkoxysilanes. These are organosilicon compounds with the general formula RO[Si](R')(OR'')OR''' (R-R''' = aliphatic organyl group). |
| External Descriptors | Not available |
| Peso molecular | 364.600 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 17 |
| Exact Mass | 364.21 Da |
| Monoisotopic Mass | 364.21 Da |
| Topological Polar Surface Area | 70.100 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 273.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
