Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(HPLC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Description
Schisandrin C is a lignan found in the fruit ofSchisandra chinensis.
| Sonrisas canónicas | CC1CC2=CC3=C(C(=C2C4=C(C5=C(C=C4CC1C)OCO5)OC)OC)OCO3 |
|---|---|
| IUPAC Name | 3,22-dimethoxy-12,13-dimethyl-5,7,18,20-tetraoxapentacyclo[13.7.0.02,10.04,8.017,21]docosa-1(22),2,4(8),9,15,17(21)-hexaene |
| InChIKey | HTBWBWWADZJXID-UHFFFAOYSA-N |
| INCHI | 1S/C22H24O6/c1-11-5-13-7-15-19(27-9-25-15)21(23-3)17(13)18-14(6-12(11)2)8-16-20(22(18)24-4)28-10-26-16/h7-8,11-12H,5-6,9-10H2,1-4H3 |
| Isómeros SMILES | CC1CC2=CC3=C(C(=C2C4=C(C5=C(C=C4CC1C)OCO5)OC)OC)OCO3 |
| WGK Alemania | 3 |
| RTECS | GX9500000 |
| PubChem CID | 119112 |
| Peso molecular | 384.428 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Phenylpropanoids and polyketides |
| Clase | Tannins |
| Subclass | Hydrolyzable tannins |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Hydrolyzable tannins |
| Alternative Parents | Dibenzocyclooctadiene lignans Benzodioxoles Anisoles Alkyl aryl ethers Oxacyclic compounds Acetals Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Hydrolyzable tannin - Dibenzocyclooctane lignan - Benzodioxole - Anisole - Alkyl aryl ether - Benzenoid - Oxacycle - Organoheterocyclic compound - Ether - Acetal - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as hydrolyzable tannins. These are tannins with a structure characterized by either of the following models. In model 1, the structure contains galloyl units (in some cases, shikimic acid units) that are linked to diverse polyol carbohydrate-, catechin-, or triterpenoid units. In model 2, contains at least two galloyl units C-C coupled to each other, and do not contain a glycosidically linked catechin unit. |
| External Descriptors | Not available |
| Peso molecular | 384.400 g/mol |
|---|---|
| XLogP3 | 5.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 384.157 Da |
| Monoisotopic Mass | 384.157 Da |
| Topological Polar Surface Area | 55.400 Ų |
| Heavy Atom Count | 28 |
| Formal Charge | 0 |
| Complexity | 509.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Zhao Zijia, Gao Yan, Yuan Min, Ye Cai, Guo Yingxue, Zhao Yanli, Li Jinlian, Cui Jiwen, Dong Tianwei, Wu Dongmei. (2024) Application Prospects of Schisandra chinensis Fruit Post-Distillation Residues in Anti-Photoaging Products: Enhancing Anti-Photoaging Through Lignans Conversion. Waste and Biomass Valorization, [PMID:] [10.1007/s12649-024-02846-0] |
| 2. Zhang Jinpeng, Cui Xinyuan, Zhao Shuo, Chang Zenghui, Zhang Junshuo, Chen Yufeng, Liu Jiale, Sun Guohao, Wang Yiyuan, Liu Yuanyuan. (2024) Establishment of a pharmacokinetics and pharmacodynamics model of Schisandra lignans against hippocampal neurotransmitters in AD rats based on microdi-alysis liquid chromatography-mass spectrometry. Frontiers in Pharmacology, [PMID:38529184] [10.3389/fphar.2024.1342121] |