Determine the necessary mass, volume, or concentration for preparing a solution.
≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=C(NC=N1)CC(C(=O)O)NC(=O)C(CO)N |
|---|---|
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | YZMPDHTZJJCGEI-BQBZGAKWSA-N |
| INCHI | 1S/C9H14N4O4/c10-6(3-14)8(15)13-7(9(16)17)1-5-2-11-4-12-5/h2,4,6-7,14H,1,3,10H2,(H,11,12)(H,13,15)(H,16,17)/t6-,7-/m0/s1 |
| Isómeros SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)NC(=O)[C@H](CO)N |
| CAS alternativo | 67726-09-4 |
| PubChem CID | 7016094 |
| Términos de entrada MeSH | Ser-His;seryl-histidine |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Peptides |
| Direct Parent | Dipeptides |
| Alternative Parents | Histidine and derivatives N-acyl-L-alpha-amino acids Serine and derivatives Alpha amino acid amides Imidazolyl carboxylic acids and derivatives Heteroaromatic compounds Secondary carboxylic acid amides Amino acids Carboxylic acid salts Azacyclic compounds Carboxylic acids Monocarboxylic acids and derivatives Hydrocarbon derivatives Monoalkylamines Organic oxides Organic salts Carbonyl compounds Organic zwitterions Organopnictogen compounds Primary alcohols |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alpha-dipeptide - Histidine or derivatives - N-acyl-alpha-amino acid - N-acyl-l-alpha-amino acid - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - Serine or derivatives - Alpha-amino acid or derivatives - Imidazolyl carboxylic acid derivative - Azole - Imidazole - Heteroaromatic compound - Amino acid or derivatives - Carboxamide group - Carboxylic acid salt - Amino acid - Secondary carboxylic acid amide - Organoheterocyclic compound - Carboxylic acid - Monocarboxylic acid or derivatives - Azacycle - Primary alcohol - Hydrocarbon derivative - Organonitrogen compound - Primary aliphatic amine - Amine - Organic oxide - Organooxygen compound - Organic oxygen compound - Organic nitrogen compound - Carbonyl group - Organopnictogen compound - Primary amine - Alcohol - Organic zwitterion - Organic salt - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. |
| External Descriptors | dipeptide |
| Peso molecular | 242.230 g/mol |
|---|---|
| XLogP3 | -4.500 |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 6 |
| Exact Mass | 242.102 Da |
| Monoisotopic Mass | 242.102 Da |
| Topological Polar Surface Area | 141.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 286.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |