Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C(=C(C(F)(F)F)[O-])C(=O)C(F)(F)F.[Na+] |
|---|---|
| IUPAC Name | sodium;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate |
| InChIKey | AWUDPEKDPFGDOP-ODZAUARKSA-M |
| INCHI | 1S/C5H2F6O2.Na/c6-4(7,8)2(12)1-3(13)5(9,10)11;/h1,12H;/q;+1/p-1/b2-1-; |
| Isómeros SMILES | C(=C(/C(F)(F)F)\[O-])\C(=O)C(F)(F)F.[Na+] |
| PubChem CID | 6028425 |
| Peso molecular | 230.04 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Alpha,beta-unsaturated carbonyl compounds - Alpha,beta-unsaturated ketones |
| Direct Parent | Enones |
| Alternative Parents | Vinylogous acids Alpha-haloketones Acryloyl compounds Organic metal halides Enolates Organofluorides Organic sodium salts Organic oxides Hydrocarbon derivatives Alkyl fluorides Organic cations |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Alpha-haloketone - Acryloyl-group - Enone - Vinylogous acid - Ketone - Organic metal halide - Enolate - Organic alkali metal salt - Organofluoride - Organohalogen compound - Hydrocarbon derivative - Organic oxide - Alkyl halide - Organic salt - Alkyl fluoride - Organic sodium salt - Organic cation - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as enones. These are compounds containing the enone functional group, with the structure RC(=O)CR'. |
| External Descriptors | Not available |
| Sensibilidad | hygroscopic |
|---|---|
| Peso molecular | 230.040 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 1 |
| Exact Mass | 229.978 Da |
| Monoisotopic Mass | 229.978 Da |
| Topological Polar Surface Area | 40.100 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 240.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 2 |