Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCC(CCC(C)C1CCC2C1(CCC3C2CC(C4(C3(CCC(C4)O)C)O)O)C)C(C)C |
|---|---|
| IUPAC Name | (3S,5R,6R,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,6-triol |
| InChIKey | VGSSUFQMXBFFTM-METNKUIYSA-N |
| INCHI | 1S/C29H52O3/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-22-16-26(31)29(32)17-21(30)12-15-28(29,6)25(22)13-14-27(23,24)5/h18-26,30-32H,7-17H2,1-6H3/t19-,20-,21+,22+,23-,24+,25+,26-,27-,28-,29+/m1/s1 |
| Isómeros SMILES | CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@H]([C@@]4([C@@]3(CC[C@@H](C4)O)C)O)O)C)C(C)C |
| CAS alternativo | 20835-91-0 |
| PubChem CID | 3036251 |
| Términos de entrada MeSH | 5 alpha-stigmastane-3 beta,5,6 beta-triol 3-monobenzoate;5 alpha-stigmastane-3 beta,5,6 beta-triol 3-monobenzoate, (3beta)-isomer |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Clase | Steroids and steroid derivatives |
| Subclass | Stigmastanes and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Stigmastanes and derivatives |
| Alternative Parents | Triterpenoids C24-propyl sterols and derivatives 6-hydroxysteroids 3-beta-hydroxysteroids Tertiary alcohols Secondary alcohols Cyclic alcohols and derivatives Polyols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | C24-propyl-sterol-skeleton - Triterpenoid - Stigmastane-skeleton - 3-hydroxysteroid - 3-beta-hydroxysteroid - 6-hydroxysteroid - 5-hydroxysteroid - Hydroxysteroid - Cyclic alcohol - Tertiary alcohol - Secondary alcohol - Polyol - Alcohol - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Aliphatic homopolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as stigmastanes and derivatives. These are sterol lipids with a structure based on the stigmastane skeleton, which consists of a cholestane moiety bearing an ethyl group at the carbon atom C24. |
| External Descriptors | 3beta-hydroxy steroid - triol - 5alpha-hydroxy steroid - 6beta-hydroxy steroid |
| Peso molecular | 448.700 g/mol |
|---|---|
| XLogP3 | 7.800 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 6 |
| Exact Mass | 448.392 Da |
| Monoisotopic Mass | 448.392 Da |
| Topological Polar Surface Area | 60.700 Ų |
| Heavy Atom Count | 32 |
| Formal Charge | 0 |
| Complexity | 663.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 11 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |