Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Tegadifur is a fluoride-containing drug with antimetabolic properties.
| Sonrisas canónicas | C1CC(OC1)N2C=C(C(=O)N(C2=O)C3CCCO3)F |
|---|---|
| IUPAC Name | 5-fluoro-1,3-bis(oxolan-2-yl)pyrimidine-2,4-dione |
| InChIKey | FLMBDTNCANYTCP-UHFFFAOYSA-N |
| INCHI | 1S/C12H15FN2O4/c13-8-7-14(9-3-1-5-18-9)12(17)15(11(8)16)10-4-2-6-19-10/h7,9-10H,1-6H2 |
| Isómeros SMILES | C1CC(OC1)N2C=C(C(=O)N(C2=O)C3CCCO3)F |
| CAS alternativo | 73120-85-1,62987-05-7 |
| PubChem CID | 124956 |
| Términos de entrada MeSH | 1,3-bis(tetrahydro-2-furanyl)-5-fluoro-2,4-pyrimidinedione;1,3-bis(tetrahydro-2-furanyl)-5-fluorouracil;5-fluoro-1,3-bis(tetrahydro-2-furanyl)-2,4-pyrimidinedione;FD 1;FD-1 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Diazines |
| Subclass | Pyrimidines and pyrimidine derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Halopyrimidines |
| Alternative Parents | Pyrimidones Aryl fluorides Hydropyrimidines Vinylogous amides Heteroaromatic compounds Tetrahydrofurans Lactams Ureas Oxacyclic compounds Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Halopyrimidine - Pyrimidone - Aryl fluoride - Aryl halide - Hydropyrimidine - Tetrahydrofuran - Vinylogous amide - Heteroaromatic compound - Urea - Lactam - Azacycle - Oxacycle - Organic nitrogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as halopyrimidines. These are aromatic compounds containing a halogen atom linked to a pyrimidine ring. Pyrimidine is a 6-membered ring consisting of four carbon atoms and two nitrogen centers at the 1- and 3- ring positions. |
| External Descriptors | Not available |
| Peso molecular | 270.260 g/mol |
|---|---|
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Exact Mass | 270.102 Da |
| Monoisotopic Mass | 270.102 Da |
| Topological Polar Surface Area | 59.100 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 439.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |