Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCOP(=O)(OCC)SCS(=O)C(C)(C)C |
|---|---|
| IUPAC Name | 2-(diethoxyphosphorylsulfanylmethylsulfinyl)-2-methylpropane |
| InChIKey | KHPIRTIPNKMGNN-UHFFFAOYSA-N |
| INCHI | 1S/C9H21O4PS2/c1-6-12-14(10,13-7-2)15-8-16(11)9(3,4)5/h6-8H2,1-5H3 |
| Isómeros SMILES | CCOP(=O)(OCC)SCS(=O)C(C)(C)C |
| CAS alternativo | 56165-57-2 |
| PubChem CID | 92037 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organosulfur compounds |
| Clase | Sulfoxides |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Sulfoxides |
| Alternative Parents | Sulfinyl compounds Sulfenyl compounds Organothiophosphorus compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Sulfoxide - Sulfenyl compound - Sulfinyl compound - Organothiophosphorus compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as sulfoxides. These are compounds containing a sulfoxide functional group, with the structure RS(=O)R' (R,R' not H). |
| External Descriptors | Not available |
| Peso molecular | 288.400 g/mol |
|---|---|
| XLogP3 | 0.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 8 |
| Exact Mass | 288.062 Da |
| Monoisotopic Mass | 288.062 Da |
| Topological Polar Surface Area | 97.100 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 265.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |