Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(C)(C)OC(=O)N1CCC2(C1)CNC(=O)CN2 |
|---|---|
| IUPAC Name | tert-butyl 8-oxo-2,6,9-triazaspiro[4.5]decane-2-carboxylate |
| InChIKey | ROMVOPIIRBONLN-UHFFFAOYSA-N |
| INCHI | 1S/C12H21N3O3/c1-11(2,3)18-10(17)15-5-4-12(8-15)7-13-9(16)6-14-12/h14H,4-8H2,1-3H3,(H,13,16) |
| Isómeros SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CNC(=O)CN2 |
| CAS alternativo | 1160247-09-5 |
| PubChem CID | 71305891 |
| Peso molecular | 255.31 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Alpha amino acid amides |
| Alternative Parents | Pyrrolidine carboxylic acids Piperazines Carbamate esters Secondary carboxylic acid amides Lactams Dialkylamines Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Alpha-amino acid amide - Pyrrolidine carboxylic acid - Pyrrolidine carboxylic acid or derivatives - 1,4-diazinane - Piperazine - Pyrrolidine - Carbamic acid ester - Secondary carboxylic acid amide - Lactam - Carboxamide group - Secondary amine - Azacycle - Secondary aliphatic amine - Organoheterocyclic compound - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Carbonyl group - Amine - Organic nitrogen compound - Aliphatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as alpha amino acid amides. These are amide derivatives of alpha amino acids. |
| External Descriptors | Not available |
| Peso molecular | 255.310 g/mol |
|---|---|
| XLogP3 | -0.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 255.158 Da |
| Monoisotopic Mass | 255.158 Da |
| Topological Polar Surface Area | 70.700 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 364.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |