Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(C)(C)OC(=O)NS(=O)(=O)C1(CC1)C=O |
|---|---|
| IUPAC Name | tert-butyl N-(1-formylcyclopropyl)sulfonylcarbamate |
| InChIKey | SHRAAPJUZKMNEU-UHFFFAOYSA-N |
| INCHI | 1S/C9H15NO5S/c1-8(2,3)15-7(12)10-16(13,14)9(6-11)4-5-9/h6H,4-5H2,1-3H3,(H,10,12) |
| Isómeros SMILES | CC(C)(C)OC(=O)NS(=O)(=O)C1(CC1)C=O |
| PubChem CID | 57816679 |
| Peso molecular | 249.28 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Organic sulfonic acids and derivatives |
| Subclass | Organosulfonic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organosulfonic acids and derivatives |
| Alternative Parents | Aminosulfonyl compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Aldehydes |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Aminosulfonyl compound - Sulfonyl - Organosulfonic acid or derivatives - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aldehyde - Aliphatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as organosulfonic acids and derivatives. These are compounds containing a sulfonic acid or derivative, with the general structure RS(=O)2X (R=alkyl, aryl; X=any heteroatom). |
| External Descriptors | Not available |
| Peso molecular | 249.290 g/mol |
|---|---|
| XLogP3 | 0.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 5 |
| Exact Mass | 249.067 Da |
| Monoisotopic Mass | 249.067 Da |
| Topological Polar Surface Area | 97.900 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 397.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |