Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCCCC[N+](CCCCC)(CCCCC)CCCCC.[Cl-] |
|---|---|
| IUPAC Name | tetrapentylazanium;chloride |
| InChIKey | SXAWRMKQZKPHNJ-UHFFFAOYSA-M |
| INCHI | 1S/C20H44N.ClH/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;/h5-20H2,1-4H3;1H/q+1;/p-1 |
| Isómeros SMILES | CCCCC[N+](CCCCC)(CCCCC)CCCCC.[Cl-] |
| WGK Alemania | 3 |
| RTECS | RZ9275000 |
| PubChem CID | 78667 |
| Peso molecular | 334.03 |
| Beilstein | 3573670 |
| Reaxy-Rn | 3573674 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | Quaternary ammonium salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tetraalkylammonium salts |
| Alternative Parents | Organopnictogen compounds Organic chloride salts Hydrocarbon derivatives Amines |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tetraalkylammonium salt - Organopnictogen compound - Hydrocarbon derivative - Organic chloride salt - Organic salt - Amine - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as tetraalkylammonium salts. These are organonitrogen compounds containing a quaternary ammonium substituted with four alkyl chains. |
| External Descriptors | Not available |
| Sensibilidad | Hygroscopic;Moisture sensitive |
|---|---|
| Peso molecular | 334.000 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 16 |
| Exact Mass | 333.316 Da |
| Monoisotopic Mass | 333.316 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 155.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Zaichao Guo, Fujin Li, Xuanxuan Wu, Zhihao Liang, Muhammad Junaid, Jianjun Xie, Liang Lu, Jinglai Duan, Jie Liu, Huijun Yao. (2023) Efficient ion sieving and ion transport properties in sub-nanoporous polyetherimide membranes. DESALINATION, [PMID:] [10.1016/j.desal.2023.117192] |
| 2. Yingjie Luo, Junjie Qiu, Qiwei Xu, Jing Wei, Hang Song, Beibei Guo, Xuesong Liu, Yong Chen, Tengfei Xu. (2025) An unconventional separation method of α-Terpineol from its isomer 1,8-Cineole via in situ-association formation of deep eutectic solvent and machine learning. JOURNAL OF CHROMATOGRAPHY A, [PMID:39862540] [10.1016/j.chroma.2025.465677] |