Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| ALogP | 0.5 |
|---|
| Sonrisas canónicas | CCOP(=O)(C(N(C)C)P(=O)(OCC)OCC)OCC |
|---|---|
| IUPAC Name | 1,1-bis(diethoxyphosphoryl)-N,N-dimethylmethanamine |
| InChIKey | SQDDGOVNJMIFFT-UHFFFAOYSA-N |
| INCHI | 1S/C11H27NO6P2/c1-7-15-19(13,16-8-2)11(12(5)6)20(14,17-9-3)18-10-4/h11H,7-10H2,1-6H3 |
| Isómeros SMILES | CCOP(=O)(C(N(C)C)P(=O)(OCC)OCC)OCC |
| PubChem CID | 86795 |
| Peso molecular | 331.28 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Organic phosphonic acids and derivatives |
| Subclass | Bisphosphonates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Bisphosphonates |
| Alternative Parents | Dialkyl alkylphosphonates Phosphonic acid esters Organopnictogen compounds Organophosphorus compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Bisphosphonate - Dialkyl alkylphosphonate - Phosphonic acid diester - Phosphonic acid ester - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organophosphorus compound - Organooxygen compound - Organonitrogen compound - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as bisphosphonates. These are organic compounds containing two phosphonate groups linked together through a carbon atoms. |
| External Descriptors | Not available |
| Peso molecular | 331.280 g/mol |
|---|---|
| XLogP3 | 0.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 11 |
| Exact Mass | 331.131 Da |
| Monoisotopic Mass | 331.131 Da |
| Topological Polar Surface Area | 74.300 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 313.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |