Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(=O)O[Sn](C)(C)O[Sn](C)(C)OC(=O)C |
|---|---|
| IUPAC Name | [[acetyloxy(dimethyl)stannyl]oxy-dimethylstannyl] acetate |
| InChIKey | VNRQFTQKKOQJIA-UHFFFAOYSA-L |
| INCHI | 1S/2C2H4O2.4CH3.O.2Sn/c2*1-2(3)4;;;;;;;/h2*1H3,(H,3,4);4*1H3;;;/q;;;;;;;2*+1/p-2 |
| Isómeros SMILES | CC(=O)O[Sn](C)(C)O[Sn](C)(C)OC(=O)C |
| PubChem CID | 16683964 |
| Peso molecular | 431.61 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Dicarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dicarboxylic acids and derivatives |
| Alternative Parents | Acetate salts Dialkyltin salts Organic tin salts Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Dicarboxylic acid or derivatives - Acetate salt - Dialkyltin salt - Carboxylic acid salt - Dialkyltin - Organic metal salt - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organic tin salt - Organic salt - Organooxygen compound - Organometallic compound - Organic post-transition metal moeity - Carbonyl group - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as dicarboxylic acids and derivatives. These are organic compounds containing exactly two carboxylic acid groups. |
| External Descriptors | Not available |
| Sensibilidad | moisture sensitive |
|---|---|
| Punto de fusión (°C) | 240°C |
| Peso molecular | 431.650 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 6 |
| Exact Mass | 431.919 Da |
| Monoisotopic Mass | 433.92 Da |
| Topological Polar Surface Area | 61.800 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 236.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |