Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCCCC[Sn](CCCCC)(CCCCC)CCCCC |
|---|---|
| IUPAC Name | tetrapentylstannane |
| InChIKey | JEHHMOWXLBXVHN-UHFFFAOYSA-N |
| INCHI | 1S/4C5H11.Sn/c4*1-3-5-4-2;/h4*1,3-5H2,2H3; |
| Isómeros SMILES | CCCCC[Sn](CCCCC)(CCCCC)CCCCC |
| PubChem CID | 96902 |
| Peso molecular | 403.282 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Clase | Organo-post-transition metal compounds |
| Subclass | Organotin compounds |
| Intermediate Tree Nodes | Tetraorganotin compounds |
| Direct Parent | Tetraalkyltins |
| Alternative Parents | Organic salts Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tetraalkyltin - Hydrocarbon derivative - Organic salt - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as tetraalkyltins. These are tetraorganotin compounds where the tin atom is linked to exactly four alkyl groups. |
| External Descriptors | Not available |
| Peso molecular | 403.300 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 16 |
| Exact Mass | 404.247 Da |
| Monoisotopic Mass | 404.247 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 155.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |