Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Thyroxine 4 ' -O-β-D-glucuronide is a metabolic derivative of thyroxine, which aims to explore and elucidate the complexity of thyroid hormone metabolism and regulation. Its unique structure combines the glucuronic acid part, making it a valuable tool for studying the biotransformation process of thyroxine, especially its phase II metabolism. In this process, it undergoes a binding reaction to make the molecule more water-soluble and thus easier to excrete. This derivative plays a key role in research focused on understanding the dynamics of thyroid hormone distribution and elimination, providing insights into the complexity of hormone homeostasis mechanisms and endocrine system functions. As a model compound, thyroxine 4 ' -O-β-D-glucuronide is helpful to develop analytical techniques for the detection and quantification of hormone metabolites, and further promote our understanding of thyroid physiology and metabolic pathways that regulate the activity of its biological system.
| Sonrisas canónicas | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)OC3C(C(C(C(O3)C(=O)O)O)O)O)I)I)CC(C(=O)O)N |
|---|---|
| IUPAC Name | (2S,3S,4S,5R)-6-[4-[4-[(2S)-2-amino-2-carboxyethyl]-2,6-diiodophenoxy]-2,6-diiodophenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | RGHRJBIKIYUHEV-SGPDEFQSSA-N |
| INCHI | 1S/C21H19I4NO10/c22-8-1-6(3-12(26)19(30)31)2-9(23)16(8)34-7-4-10(24)17(11(25)5-7)35-21-15(29)13(27)14(28)18(36-21)20(32)33/h1-2,4-5,12-15,18,21,27-29H,3,26H2,(H,30,31)(H,32,33)/t12-,13-,14-,15+,18-,21?/m0/s1 |
| Isómeros SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)OC3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O)I)I)C[C@@H](C(=O)O)N |
| Peso molecular | 952.99 |
| Reaxy-Rn | 14820214 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14820214&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Sensibilidad | Moisture sensitive |
|---|---|
| Punto de fusión (°C) | >169° C (dec.) |