Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C(C(Cl)(Cl)Cl)OP(=O)(O)[O-].[Na+] |
|---|---|
| IUPAC Name | sodium;2,2,2-trichloroethyl hydrogen phosphate |
| InChIKey | WFKJEZKHPGDCRK-UHFFFAOYSA-M |
| INCHI | 1S/C2H4Cl3O4P.Na/c3-2(4,5)1-9-10(6,7)8;/h1H2,(H2,6,7,8);/q;+1/p-1 |
| Isómeros SMILES | C(C(Cl)(Cl)Cl)OP(=O)(O)[O-].[Na+] |
| Peso molecular | 251.36 |
| Reaxy-Rn | 15339614 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=15339614&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Organic phosphoric acids and derivatives |
| Subclass | Phosphate esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkyl phosphates |
| Alternative Parents | Organic metal halides Organooxygen compounds Organochlorides Organic sodium salts Organic oxides Hydrocarbon derivatives Alkyl chlorides Organic cations |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Alkyl phosphate - Organic metal halide - Organic alkali metal salt - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organic sodium salt - Organic salt - Organooxygen compound - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Organic cation - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as alkyl phosphates. These are organic compounds containing a phosphate group that is linked to one or more alkyl chains. |
| External Descriptors | Not available |
| Peso molecular | 251.360 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 249.873 Da |
| Monoisotopic Mass | 249.873 Da |
| Topological Polar Surface Area | 69.600 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 158.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Honglin Li, Congcong Du, Ting Guo, Hongyuan Zhou, Ying Zhou, Xinrui Huang, Yu Hao Zhang, Shuo Wang, Xiaozhu Liu, Liang Ma. (2023) Ratiometric electrochemical aptasensor based on split aptamer and Au-RGO for detection of Aflatoxin M1. JOURNAL OF DAIRY SCIENCE, [PMID:38101746] [10.3168/jds.2023-23864] |