Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | [B-](COCC1=CC=C(C=C1)OC)(F)(F)F |
|---|---|
| IUPAC Name | trifluoro-[(4-methoxyphenyl)methoxymethyl]boranuide |
| InChIKey | OUXWPRVDRCMHOF-UHFFFAOYSA-N |
| INCHI | 1S/C9H11BF3O2/c1-14-9-4-2-8(3-5-9)6-15-7-10(11,12)13/h2-5H,6-7H2,1H3/q-1 |
| Peso molecular | 218.990 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzylethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzylethers |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Anisoles Alkyl aryl ethers Boronic acid derivatives Alkylhaloboranes Organic metalloid salts Dialkyl ethers Monoalkylboranes Hydrocarbon derivatives Organic anions |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzylether - Phenoxy compound - Anisole - Phenol ether - Methoxybenzene - Alkyl aryl ether - Alkylhaloborane - Boronic acid derivative - Ether - Dialkyl ether - Organic metalloid salt - Alkylborane - Organooxygen compound - Organic metalloid moeity - Monoalkylborane - Organic oxygen compound - Hydrocarbon derivative - Organic anion - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as benzylethers. These are aromatic ethers with the general formula ROCR' (R = alkyl, aryl; R'=benzene). |
| External Descriptors | Not available |
| Peso molecular | 218.990 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 4 |
| Exact Mass | 219.08 Da |
| Monoisotopic Mass | 219.08 Da |
| Topological Polar Surface Area | 18.500 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | -1 |
| Complexity | 179.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |