Determine the necessary mass, volume, or concentration for preparing a solution.
≥96% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CO[Si](C1=CC=C(C=C1)C=C)(OC)OC |
|---|---|
| IUPAC Name | (4-ethenylphenyl)-trimethoxysilane |
| InChIKey | LTQBNYCMVZQRSD-UHFFFAOYSA-N |
| INCHI | 1S/C11H16O3Si/c1-5-10-6-8-11(9-7-10)15(12-2,13-3)14-4/h5-9H,1H2,2-4H3 |
| Isómeros SMILES | CO[Si](C1=CC=C(C=C1)C=C)(OC)OC |
| Peso molecular | 224.33 |
| Reaxy-Rn | 2839265 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Styrenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Styrenes |
| Alternative Parents | Trialkoxysilanes Silyl ethers Organoheterosilanes Organic metalloid salts Organooxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Trialkoxysilane - Styrene - Alkoxysilane - Silyl ether - Organoheterosilane - Organic metalloid salt - Organic oxygen compound - Hydrocarbon derivative - Organosilicon compound - Organooxygen compound - Organic metalloid moeity - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as styrenes. These are organic compounds containing an ethenylbenzene moiety. |
| External Descriptors | Not available |
| Sensibilidad | Moisture Sensitive |
|---|---|
| Índice de refracción | 1.5 |
| Punto de ebullición (°C) | 77°C/0.2mmHg(lit.) |
| Peso molecular | 224.330 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 224.087 Da |
| Monoisotopic Mass | 224.087 Da |
| Topological Polar Surface Area | 27.700 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 188.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |