10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 3 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
VBIT-12 is a potent inhibitor of Voltage-dependent anion-selective channel 1 (VDAC1), directly interacting with purified VDAC1, reducing its channel conductance and preventing VDAC1 oligomerization.
| ALogP | -0.183 |
|---|---|
| Recuento HBD | 2 |
| Enlace rotable | 7 |
| Sonrisas canónicas | C1CN(CCC1(C(=O)NCC(=O)O)NC2=CC=CC=C2)CC3=CC=CC4=CC=CC=C43 |
|---|---|
| IUPAC Name | 2-[[4-anilino-1-(naphthalen-1-ylmethyl)piperidine-4-carbonyl]amino]acetic acid |
| InChIKey | JZDHWOWCHGYSGA-UHFFFAOYSA-N |
| INCHI | 1S/C25H27N3O3/c29-23(30)17-26-24(31)25(27-21-10-2-1-3-11-21)13-15-28(16-14-25)18-20-9-6-8-19-7-4-5-12-22(19)20/h1-12,27H,13-18H2,(H,26,31)(H,29,30) |
| PubChem CID | 134347604 |
| Peso molecular | 417.5 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Sensibilidad | light sensitive |
|---|---|
| DMSO (mg/ml) Solubilidad máxima | 83 |
| DMSO (mM) Solubilidad máxima | 198.802395209581 |
| Agua (mg/ml) Solubilidad máxima | 2 |
| Agua (mM) Solubilidad máxima | 4.79041916167665 |
| Peso molecular | 417.500 g/mol |
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 7 |
| Exact Mass | 417.205 Da |
| Monoisotopic Mass | 417.205 Da |
| Topological Polar Surface Area | 81.700 Ų |
| Heavy Atom Count | 31 |
| Formal Charge | 0 |
| Complexity | 611.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Jixun Li, Ruzhen Feng, Wei Yang, Peiyao Liang, Tianming Qiu, Jingyuan Zhang, Xiance Sun, Qiujuan Li, Guang Yang, Xiaofeng Yao. (2024) Lysosomal iron accumulation and subsequent lysosomes-mitochondria iron transmission mediate PFOS-induced hepatocyte ferroptosis. ECOTOXICOLOGY AND ENVIRONMENTAL SAFETY, [PMID:39146593] [10.1016/j.ecoenv.2024.116890] |
| 2. Wei Yang, Yu Li, Ruzhen Feng, Peiyao Liang, Kefan Tian, Lingli Hu, Kejing Wang, Tianming Qiu, Jingyuan Zhang, Xiance Sun, Xiaofeng Yao. (2025) PFOS causes lysosomes-regulated mitochondrial fission through TRPML1-VDAC1 and oligomerization of MCU/ATP5J2. JOURNAL OF HAZARDOUS MATERIALS, [PMID:39983639] [10.1016/j.jhazmat.2025.137685] |
| 3. Yu Ma, Wei Yang, Peiyao Liang, Ruzhen Feng, Tianming Qiu, Jingyuan Zhang, Xiance Sun, Qiujuan Li, Guang Yang, Xiaofeng Yao. (2024) The VDAC1 oligomerization regulated by ATP5B leads to the NLRP3 inflammasome activation in the liver cells under PFOS exposure. ECOTOXICOLOGY AND ENVIRONMENTAL SAFETY, [PMID:38944014] [10.1016/j.ecoenv.2024.116647] |
