Determine the necessary mass, volume, or concentration for preparing a solution.
10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
multi drug resistance modulators; Fungicidal;
| ALogP | 2.238 |
|---|---|
| Recuento HBD | 1 |
| Enlace rotable | 4 |
| Sonrisas canónicas | COC(=O)C1=CC=CC=C1NC(=O)C2=CC3=C(C=C2)OCO3 |
|---|---|
| IUPAC Name | methyl 2-(1,3-benzodioxole-5-carbonylamino)benzoate |
| InChIKey | BPHJTPDQSNWPMH-UHFFFAOYSA-N |
| INCHI | 1S/C16H13NO5/c1-20-16(19)11-4-2-3-5-12(11)17-15(18)10-6-7-13-14(8-10)22-9-21-13/h2-8H,9H2,1H3,(H,17,18) |
| Isómeros SMILES | COC(=O)C1=CC=CC=C1NC(=O)C2=CC3=C(C=C2)OCO3 |
| PubChem CID | 669576 |
| Peso molecular | 299.28 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Anilides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aromatic anilides |
| Alternative Parents | Benzoic acid esters Benzodioxoles Benzoyl derivatives Vinylogous amides Methyl esters Secondary carboxylic acid amides Oxacyclic compounds Monocarboxylic acids and derivatives Acetals Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Aromatic anilide - Benzoate ester - Benzodioxole - Benzoic acid or derivatives - Benzoyl - Vinylogous amide - Methyl ester - Carboxamide group - Carboxylic acid ester - Secondary carboxylic acid amide - Acetal - Carboxylic acid derivative - Oxacycle - Monocarboxylic acid or derivatives - Organoheterocyclic compound - Hydrocarbon derivative - Organic oxide - Organic nitrogen compound - Organic oxygen compound - Organonitrogen compound - Organooxygen compound - Organopnictogen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as aromatic anilides. These are aromatic compounds containing an anilide group in which the carboxamide group is substituted with an aromatic group. They have the general structure RNC(=O)R', where R= benzene, and R = aryl group. |
| External Descriptors | Not available |
| DMSO (mM) Solubilidad máxima | 10 |
|---|---|
| Peso molecular | 299.280 g/mol |
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Exact Mass | 299.079 Da |
| Monoisotopic Mass | 299.079 Da |
| Topological Polar Surface Area | 73.900 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 427.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |