10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
anti-fungi
| ALogP | 2.497 |
|---|---|
| Enlace rotable | 2 |
| Sonrisas canónicas | CC1=CC(=C(O1)C)C(=O)N(C)C2CCCCC2 |
|---|---|
| IUPAC Name | N-cyclohexyl-N,2,5-trimethylfuran-3-carboxamide |
| InChIKey | ODJSWKKZDKJJEK-UHFFFAOYSA-N |
| INCHI | 1S/C14H21NO2/c1-10-9-13(11(2)17-10)14(16)15(3)12-7-5-4-6-8-12/h9,12H,4-8H2,1-3H3 |
| Isómeros SMILES | CC1=CC(=C(O1)C)C(=O)N(C)C2CCCCC2 |
| PubChem CID | 2101215 |
| Peso molecular | 235.32 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Furans |
| Subclass | Furoic acid and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Furan-3-carboxylic acid and derivatives |
| Alternative Parents | Tertiary carboxylic acid amides Heteroaromatic compounds Oxacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Furan-3-carboxylic acid or derivatives - Heteroaromatic compound - Tertiary carboxylic acid amide - Carboxamide group - Oxacycle - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as furan-3-carboxylic acid and derivatives. These are aromatic heterocyclic compounds containing a furan ring, which carries a carboxyl group or a derivative thereof at the ring 3-position. |
| External Descriptors | Not available |
| DMSO (mM) Solubilidad máxima | 10 |
|---|---|
| Peso molecular | 235.320 g/mol |
| XLogP3 | 3.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 235.157 Da |
| Monoisotopic Mass | 235.157 Da |
| Topological Polar Surface Area | 33.500 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 273.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
