Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1(C=CC2=C(O1)C3=C(C(=CC=C3)OC)N(C2=O)C)C |
|---|---|
| IUPAC Name | 7-methoxy-2,2,6-trimethylpyrano[3,2-c]quinolin-5-one |
| InChIKey | SYNIFQKDJZQOLI-UHFFFAOYSA-N |
| INCHI | 1S/C16H17NO3/c1-16(2)9-8-11-14(20-16)10-6-5-7-12(19-4)13(10)17(3)15(11)18/h5-9H,1-4H3 |
| Isómeros SMILES | CC1(C=CC2=C(O1)C3=C(C(=CC=C3)OC)N(C2=O)C)C |
| PubChem CID | 5315422 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Quinolines and derivatives |
| Subclass | Quinolones and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyranoquinolines |
| Alternative Parents | Hydroquinolones Pyranopyridines Hydroquinolines Anisoles Pyridinones Alkyl aryl ethers Pyrans Vinylogous esters Heteroaromatic compounds Lactams Oxacyclic compounds Azacyclic compounds Hydrocarbon derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyranoquinoline - Dihydroquinolone - Dihydroquinoline - Pyranopyridine - Anisole - Alkyl aryl ether - Pyridinone - Pyran - Pyridine - Benzenoid - Heteroaromatic compound - Vinylogous ester - Lactam - Oxacycle - Ether - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as pyranoquinolines. These are polycyclic compounds containing a pyran ring fused to a quinoline moiety. Quinoline or benzo[b]pyridine is a bicyclic compound that consists of benzene fused to a pyridine. |
| External Descriptors | Not available |
| Peso molecular | 271.310 g/mol |
|---|---|
| XLogP3 | 2.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 271.121 Da |
| Monoisotopic Mass | 271.121 Da |
| Topological Polar Surface Area | 38.800 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 492.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |