10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
(-)-Fenchone is a bridged bicyclic ketone found in fennel oil and thuja oil.
(-)-Fenchone undergoes condensation with pyridinylalkylamines to form chiral iminopyridine ligands, which find applications in enantioselective copper-catalyzed Henry (nitro aldol) reaction.It may also be used in the preparation of enantiopure C(7)-anti-substituted fenchones as new chiral sources.
| Pubchem Sid | 528752721 |
|---|---|
| 정식 스마일 | CC1(C2CCC(C2)(C1=O)C)C |
| IUPAC Name | (1R,4S)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-one |
| InChIKey | LHXDLQBQYFFVNW-OIBJUYFYSA-N |
| INCHI | 1S/C10H16O/c1-9(2)7-4-5-10(3,6-7)8(9)11/h7H,4-6H2,1-3H3/t7-,10+/m0/s1 |
| 이성체 SMILES | C[C@@]12CC[C@@H](C1)C(C2=O)(C)C |
| WGK 독일 | 3 |
| UN 번호 | 3082 |
| 포장 그룹 | III |
| 분자량 | 152.24 |
| Reaxy-Rn | 1861492 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1861492&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| 분류 | Prenol lipids |
| Subclass | Monoterpenoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Bicyclic monoterpenoids |
| Alternative Parents | Ketones Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Fenchane monoterpenoid - Bicyclic monoterpenoid - Ketone - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic homopolycyclic compound |
| 설명 | This compound belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other. |
| External Descriptors | Bicyclic monoterpenoids |
| 감도 | Heat sensitive |
|---|---|
| 굴절률 | 1.4600 to 1.4630 |
| 특정 회전[α] | -50.0 to -55.0 deg(neat) |
| 발화점(°F) | 125.6 °F |
| 발화점(°C) | 52°C |
| 끓는점(°C) | 193°C |
| 녹는점(°C) | 5-6°C |
| 분자량 | 152.230 g/mol |
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 152.12 Da |
| Monoisotopic Mass | 152.12 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 217.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Yixiang Li, Yajun Bai, Tai-Ping Fan, Xiaohui Zheng, Yujie Cai. (2021) Characterization of a putative tropinone reductase from Tarenaya hassleriana with a broad substrate specificity. BIOTECHNOLOGY AND APPLIED BIOCHEMISTRY, 69 (6): (2530-2539). [PMID:34902878] [10.1002/bab.2302] |
