≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 528772028 |
|---|---|
| 정식 스마일 | C[N+](C)(C)CC(C[N+](C)(C)C)O.[I-].[I-] |
| IUPAC Name | [2-hydroxy-3-(trimethylazaniumyl)propyl]-trimethylazanium;diiodide |
| InChIKey | UOZDOLIXBYLRAC-UHFFFAOYSA-L |
| INCHI | 1S/C9H24N2O.2HI/c1-10(2,3)7-9(12)8-11(4,5)6;;/h9,12H,7-8H2,1-6H3;2*1H/q+2;;/p-2 |
| 이성체 SMILES | C[N+](C)(C)CC(C[N+](C)(C)C)O.[I-].[I-] |
| PubChem CID | 67158 |
| 분자량 | 430.11 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| 분류 | Organonitrogen compounds |
| Subclass | Quaternary ammonium salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cholines |
| Alternative Parents | Tetraalkylammonium salts Secondary alcohols 1,2-aminoalcohols Organopnictogen compounds Organic zwitterions Organic iodide salts Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Choline - Tetraalkylammonium salt - Secondary alcohol - 1,2-aminoalcohol - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organic iodide salt - Organic salt - Organic zwitterion - Organooxygen compound - Amine - Alcohol - Aliphatic acyclic compound |
| 설명 | This compound belongs to the class of organic compounds known as cholines. These are organic compounds containing a N,N,N-trimethylethanolammonium cation. |
| External Descriptors | Not available |
| 감도 | Light sensitive, Hygroscopic |
|---|---|
| 분자량 | 430.110 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 4 |
| Exact Mass | 429.998 Da |
| Monoisotopic Mass | 429.998 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 116.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
H2519323