≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
SPDP-PEG8-acid is a PEG derivative contianing SPDP crosslinker and carboxylic acid moieties. SPDP is reactive toward amine and thiol groups and contains a cleavable disulfide bond. Its membrane permeability allows for intracellular crosslinking reactions. The terminal caboxylic acid can react with primary amines in the presence of activators such as EDC and DCC to form stable amide bonds. The hydrophilic properties of the PEG linkers increase compound solubility in aqueous media. The water solubility properties of PEG linkers is enhanced by longer PEG chains.
| Pubchem Sid | 528767162 |
|---|---|
| 정식 스마일 | C1=CC=NC(=C1)SSCCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
| 이성체 SMILES | C1=CC=NC(=C1)SSCCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
| 분자량 | 638.79 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| 분자량 | 638.800 g/mol |
|---|---|
| XLogP3 | -0.700 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 14 |
| Rotatable Bond Count | 32 |
| Exact Mass | 638.254 Da |
| Monoisotopic Mass | 638.254 Da |
| Topological Polar Surface Area | 204.000 Ų |
| Heavy Atom Count | 42 |
| Formal Charge | 0 |
| Complexity | 627.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
H2528501