Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature,Argon charged Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
(4-Chlorophenyl)triethoxysilane is a nucleophile that can be utilized in Pd-catalyzed cross-coupling.
application:
(4-Chlorophenyl)triethoxysilane can be used:
To facilitate the connection between dipolar mixed monolayers and zinc oxide in photovoltaic devices.
As a substrate in the Ni-catalyzed decarboxylative coupling with alkynyl carboxylic acids to yield substituted diarylalkynes.
As a substrate in the Hiyama cross-coupling reactions with 3-iodoazetidines to yield substituted 3-arylazetidines.
As an intermediate in the synthesis of tripod-shaped oligo(p-phenylene)s, which are used in the surface immobilization of gold and CdS quantum dots for sensor applications.
| Pubchem Sid | 504755972 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504755972 |
| Sourires canoniques | CCO[Si](C1=CC=C(C=C1)Cl)(OCC)OCC |
| IUPAC Name | (4-chlorophenyl)-triethoxysilane |
| InChIKey | AFILDYMJSTXBAR-UHFFFAOYSA-N |
| INCHI | 1S/C12H19ClO3Si/c1-4-14-17(15-5-2,16-6-3)12-9-7-11(13)8-10-12/h7-10H,4-6H2,1-3H3 |
| Isomères SMILES | CCO[Si](C1=CC=C(C=C1)Cl)(OCC)OCC |
| WGK Allemagne | 3 |
| Poids moléculaire | 274.82 |
| Reaxy-Rn | 2943286 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2943286&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Classe | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Alkoxysilanes |
| Direct Parent | Trialkoxysilanes |
| Alternative Parents | Chlorobenzenes Aryl chlorides Silyl ethers Organoheterosilanes Organic metalloid salts Organooxygen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Trialkoxysilane - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Silyl ether - Organoheterosilane - Organic metalloid salt - Organic oxygen compound - Organohalogen compound - Organochloride - Organooxygen compound - Organic salt - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as trialkoxysilanes. These are organosilicon compounds with the general formula RO[Si](R')(OR'')OR''' (R-R''' = aliphatic organyl group). |
| External Descriptors | Not available |
| Sensibilité | Moisture sensitive |
|---|---|
| Point d'éclair (°F) | >230 °F |
| Point d'éclair (°C) | >110 °C |
| Point d'ébullition (°C) | 82-84° C (lit.) at 0.07 mmHg |
| Poids moléculaire | 274.810 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 7 |
| Exact Mass | 274.079 Da |
| Monoisotopic Mass | 274.079 Da |
| Topological Polar Surface Area | 27.700 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 191.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |