Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| ALogP | 5.4 |
|---|
| Sourires canoniques | OC(=O)C1=C(O)C=CC(NCCC2=CC=C(C=C2)C(F)(F)F)=C1 |
|---|---|
| IUPAC Name | 2-hydroxy-5-[2-[4-(trifluoromethyl)phenyl]ethylamino]benzoic acid |
| InChIKey | UTMVACIBQLDZLP-UHFFFAOYSA-N |
| INCHI | 1S/C16H14F3NO3/c17-16(18,19)11-3-1-10(2-4-11)7-8-20-12-5-6-14(21)13(9-12)15(22)23/h1-6,9,20-21H,7-8H2,(H,22,23) |
| Isomères SMILES | C1=CC(=CC=C1CCNC2=CC(=C(C=C2)O)C(=O)O)C(F)(F)F |
| CAS alternatif | 927685-43-6 |
| PubChem CID | 16042343 |
| Termes d'entrée MeSH | 2-hydroxy-5-(2-(4-trifluoromethylphenyl)ethylamino)benzoic acid;AAD-2004 |
| Poids moléculaire | 325.28 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Classe | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Aminobenzoic acids and derivatives |
| Direct Parent | Aminobenzoic acids |
| Alternative Parents | Salicylic acids Trifluoromethylbenzenes Benzoic acids Phenethylamines p-Aminophenols Phenylalkylamines Benzoyl derivatives Aniline and substituted anilines 1-hydroxy-2-unsubstituted benzenoids Secondary alkylarylamines Vinylogous acids Amino acids Carboxylic acids Alkyl fluorides Organooxygen compounds Organofluorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aminobenzoic acid - Hydroxybenzoic acid - Trifluoromethylbenzene - Salicylic acid or derivatives - Salicylic acid - Benzoic acid - Phenethylamine - Aminophenol - P-aminophenol - Benzoyl - Aniline or substituted anilines - Phenylalkylamine - Secondary aliphatic/aromatic amine - Phenol - Aralkylamine - 1-hydroxy-2-unsubstituted benzenoid - Vinylogous acid - Amino acid - Amino acid or derivatives - Secondary amine - Carboxylic acid derivative - Carboxylic acid - Hydrocarbon derivative - Organohalogen compound - Organofluoride - Organonitrogen compound - Amine - Alkyl halide - Alkyl fluoride - Organooxygen compound - Organic oxygen compound - Organic oxide - Organic nitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminobenzoic acids. These are benzoic acids containing an amine group attached to the benzene moiety. |
| External Descriptors | Not available |
| Poids moléculaire | 325.280 g/mol |
|---|---|
| XLogP3 | 5.400 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 5 |
| Exact Mass | 325.093 Da |
| Monoisotopic Mass | 325.093 Da |
| Topological Polar Surface Area | 69.600 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 395.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |