Determine the necessary mass, volume, or concentration for preparing a solution.
10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
A tetracyclic, histamine H1 receptor antagonist.
| Pubchem Sid | 528769973 |
|---|---|
| Sourires canoniques | C1C2C3=CC=CC=C3CC4=CC=CC=C4N2C(=N1)N.Cl |
| IUPAC Name | 2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-amine;hydrochloride |
| InChIKey | VKXSGUIOOQPGAF-UHFFFAOYSA-N |
| INCHI | 1S/C16H15N3.ClH/c17-16-18-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)19(15)16;/h1-8,15H,9-10H2,(H2,17,18);1H |
| Isomères SMILES | C1C2C3=CC=CC=C3CC4=CC=CC=C4N2C(=N1)N.Cl |
| WGK Allemagne | 3 |
| RTECS | HO4360000 |
| CAS alternatif | 80012-44-8,108929-04-0,80012-43-7 (Parent) |
| Termes d'entrée MeSH | 3-amino-9,13b-dihydro-1H-benz(c,f)imidazo(1,5a)azepine;epinastine;epinastine hydrochloride;Flurinol;WAL 80;WAL 801;WAL 801 CL;WAL 801CL;WAL-80 Cl |
| Poids moléculaire | 285.77 |
| Reaxy-Rn | 3576207 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3576207&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Classe | Benzazepines |
| Subclass | Dibenzazepines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dibenzazepines |
| Alternative Parents | Azepines Benzenoids Imidazolines Guanidines Propargyl-type 1,3-dipolar organic compounds Carboximidamides Azacyclic compounds Organopnictogen compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Dibenzazepine - Azepine - Benzenoid - 2-imidazoline - Guanidine - Azacycle - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Carboximidamide - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as dibenzazepines. These are compounds with two benzene rings connected by an azepine ring. Azepine is an unsaturated seven-member heterocycle with one nitrogen atom replacing a carbon atom. |
| External Descriptors | hydrochloride |
| Sensibilité | Moisture & Heat sensitive |
|---|---|
| Point de fusion (°C) | 275 °C(dec.) |
| Poids moléculaire | 285.770 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 285.103 Da |
| Monoisotopic Mass | 285.103 Da |
| Topological Polar Surface Area | 41.600 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 378.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Shiyan Liu, Xuefeng Zhang, Xin Gong, Jinxin Yu, Tao Lin, Qian Xiang, Xinnian Zeng, Jiali Liu. (2025) molecular and pharmacological characterization of the dopamine receptors in the oriental fruit fly, Bactrocera dorsalis. INSECT BIOCHEMISTRY AND MOLECULAR BIOLOGY, [PMID:40245998] [10.1016/j.ibmb.2025.104312] |