Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sourires canoniques | C1=CC=C2C=C(C=CC2=C1)NC(=O)CNC(=O)CN.Br |
|---|---|
| IUPAC Name | 2-amino-N-[2-(naphthalen-2-ylamino)-2-oxoethyl]acetamide;hydrobromide |
| InChIKey | HBILDMMVUMVIMF-UHFFFAOYSA-N |
| INCHI | 1S/C14H15N3O2.BrH/c15-8-13(18)16-9-14(19)17-12-6-5-10-3-1-2-4-11(10)7-12;/h1-7H,8-9,15H2,(H,16,18)(H,17,19);1H |
| Isomères SMILES | C1=CC=C2C=C(C=CC2=C1)NC(=O)CNC(=O)CN.Br |
| Poids moléculaire | 338.2 |
| Reaxy-Rn | 8731746 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8731746&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Classe | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Peptides |
| Direct Parent | Dipeptides |
| Alternative Parents | N-acyl-alpha amino acids and derivatives Alpha amino acid amides Naphthalenes N-arylamides Secondary carboxylic acid amides Organopnictogen compounds Organic oxides Monoalkylamines Hydrocarbon derivatives Hydrobromides Carbonyl compounds |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Alpha-dipeptide - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - N-substituted-alpha-amino acid - Alpha-amino acid or derivatives - Naphthalene - N-arylamide - Benzenoid - Amino acid or derivatives - Carboxamide group - Secondary carboxylic acid amide - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Primary amine - Hydrobromide - Primary aliphatic amine - Hydrocarbon derivative - Carbonyl group - Organic oxide - Amine - Organopnictogen compound - Organic oxygen compound - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. |
| External Descriptors | Not available |
| Poids moléculaire | 338.200 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 4 |
| Exact Mass | 337.043 Da |
| Monoisotopic Mass | 337.043 Da |
| Topological Polar Surface Area | 84.200 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 333.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |