Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sourires canoniques | C1C(C(C(C(C1N)OC2C(C(C(C(O2)CO)O)O)N)O)O)N |
|---|---|
| IUPAC Name | (2R,3S,4R,5R,6S)-5-amino-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxy-2-(hydroxymethyl)oxane-3,4-diol |
| InChIKey | JGSMDVGTXBPWIM-HKEUSBCWSA-N |
| INCHI | 1S/C12H25N3O7/c13-3-1-4(14)11(10(20)7(3)17)22-12-6(15)9(19)8(18)5(2-16)21-12/h3-12,16-20H,1-2,13-15H2/t3-,4+,5-,6-,7+,8-,9-,10-,11-,12-/m1/s1 |
| Isomères SMILES | C1[C@H]([C@@H]([C@H]([C@@H]([C@H]1N)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)N)O)O)N |
| CAS alternatif | 534-47-4 |
| PubChem CID | 439560 |
| Termes d'entrée MeSH | paromamine |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Classe | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Aminosaccharides - Aminoglycosides |
| Direct Parent | Aminocyclitol glycosides |
| Alternative Parents | 2-deoxystreptamine aminoglycosides Hexoses O-glycosyl compounds Aminocyclitols and derivatives Cyclohexylamines Cyclohexanols Oxanes 1,2-aminoalcohols Oxacyclic compounds Acetals Primary alcohols Organopnictogen compounds Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Amino cyclitol glycoside - 2-deoxystreptamine aminoglycoside - Hexose monosaccharide - Glycosyl compound - O-glycosyl compound - Aminocyclitol or derivatives - Cyclohexylamine - Cyclohexanol - Monosaccharide - Oxane - Cyclitol or derivatives - Cyclic alcohol - Secondary alcohol - 1,2-aminoalcohol - Organoheterocyclic compound - Acetal - Oxacycle - Organic nitrogen compound - Primary aliphatic amine - Organonitrogen compound - Primary alcohol - Primary amine - Hydrocarbon derivative - Amine - Alcohol - Organopnictogen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminocyclitol glycosides. These are organic compounds containing an amicocyclitol moiety glycosidically linked to a carbohydrate moiety. There are two major classes of aminoglycosides containing a 2-streptamine core. They are called 4,5- and 4,6-disubstituted 2-deoxystreptamines. |
| External Descriptors | primary amino compound - triamine - aminoglycoside |
| Poids moléculaire | 323.340 g/mol |
|---|---|
| XLogP3 | -5.100 |
| Hydrogen Bond Donor Count | 8 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 3 |
| Exact Mass | 323.169 Da |
| Monoisotopic Mass | 323.169 Da |
| Topological Polar Surface Area | 198.000 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 377.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 10 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |