Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1C2=C(C=CC(=C2)N)N=C3N1C(=O)C4=CC=CC=C43 |
|---|---|
| IUPAC Name | 8-amino-10H-isoindolo[1,2-b]quinazolin-12-one |
| InChIKey | SRIOCKJKFXAKHK-UHFFFAOYSA-N |
| INCHI | 1S/C15H11N3O/c16-10-5-6-13-9(7-10)8-18-14(17-13)11-3-1-2-4-12(11)15(18)19/h1-7H,8,16H2 |
| Isómeros SMILES | C1C2=C(C=CC(=C2)N)N=C3N1C(=O)C4=CC=CC=C43 |
| CAS alternativo | 67199-66-0 |
| PubChem CID | 71750 |
| Número NSC | 320846 |
| Términos de entrada MeSH | 8-aminoisoindolo(1,2-b)quinazolin-12(10H)one;batracylin;BAY H 2049;BAY H-2049;NSC 320846;NSC-320846 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Diazanaphthalenes |
| Subclass | Benzodiazines |
| Intermediate Tree Nodes | Quinazolines |
| Direct Parent | Indoloquinazolines |
| Alternative Parents | Quinazolinamines Isoindolones Isoindoles Indoles Benzenoids Amino acids and derivatives Propargyl-type 1,3-dipolar organic compounds Carboxamidines Azacyclic compounds Primary amines Organopnictogen compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Indoloquinazoline - Quinazolinamine - Isoindolone - Indole - Isoindoline - Isoindole - Isoindole or derivatives - Benzenoid - Amino acid or derivatives - Amidine - Carboxylic acid amidine - Carboxylic acid derivative - Azacycle - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Amine - Organonitrogen compound - Organooxygen compound - Primary amine - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as indoloquinazolines. These are polycyclic aromatic compounds containing an indole fused to a quinazoline. Indole is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. Quinazoline is a heterocyclic compound consisting of two fused six-membered simple aromatic rings, a benzene ring and a pyrimidine ring. |
| External Descriptors | Not available |
| Peso molecular | 249.270 g/mol |
|---|---|
| XLogP3 | 1.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 249.09 Da |
| Monoisotopic Mass | 249.09 Da |
| Topological Polar Surface Area | 58.700 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 433.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |