Determine the necessary mass, volume, or concentration for preparing a solution.
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 3 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488180821 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488180821 |
| 정식 스마일 | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)O |
| IUPAC Name | 1-hydroxyanthracene-9,10-dione |
| InChIKey | BTLXPCBPYBNQNR-UHFFFAOYSA-N |
| INCHI | 1S/C14H8O3/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7,15H |
| 이성체 SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)O |
| RTECS | CB7178000 |
| 분자량 | 224.22 |
| Beilstein | 8338 |
| Reaxy-Rn | 1912751 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1912751&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| 분류 | Anthracenes |
| Subclass | Anthraquinones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anthraquinones |
| Alternative Parents | Aryl ketones 1-hydroxy-4-unsubstituted benzenoids 1-hydroxy-2-unsubstituted benzenoids Vinylogous acids Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Anthraquinone - 9,10-anthraquinone - Aryl ketone - 1-hydroxy-4-unsubstituted benzenoid - 1-hydroxy-2-unsubstituted benzenoid - Vinylogous acid - Ketone - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic homopolycyclic compound |
| 설명 | This compound belongs to the class of organic compounds known as anthraquinones. These are organic compounds containing either anthracene-9,10-quinone, 1,4-anthraquinone, or 1,2-anthraquinone. |
| External Descriptors | a hydroxyanthraquinone |
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| 녹는점(°C) | 198°C |
|---|---|
| 분자량 | 224.210 g/mol |
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 224.047 Da |
| Monoisotopic Mass | 224.047 Da |
| Topological Polar Surface Area | 54.400 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 349.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Jiale Ding, Zengduo Cui, Ningning Dong, Bolong Li, Yunhe Zhang, Jun Wang, Zhenhua Jiang. (2020) Enhanced optical limiting properties of composite films consisting of hyperbranched phthalocyanine and polyphenylsulfone with high linear transmittance. SYNTHETIC METALS, [PMID:] [10.1016/j.synthmet.2020.116405] |
| 2. Bolong Li, Zengduo Cui, Yuping Han, Jiale Ding, Zhenhua Jiang, Yunhe Zhang. (2020) Novel axially substituted lanthanum phthalocyanines: Synthesis, photophysical and nonlinear optical properties. DYES AND PIGMENTS, [PMID:] [10.1016/j.dyepig.2020.108407] |
| 3. Xiao-Fei Shang, Zhong-Min Zhao, Jun-Cai Li, Guan-Zhou Yang, Ying-Qian Liu, Li-Xia Dai, Zhi-Jun Zhang, Zhi-Gang Yang, Xiao-Lou Miao, Cheng-Jie Yang, Ji-Yu Zhang. (2019) Insecticidal and antifungal activities of Rheum palmatum L. anthraquinones and structurally related compounds. INDUSTRIAL CROPS AND PRODUCTS, [PMID:] [10.1016/j.indcrop.2019.05.055] |