Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light,Argon charged,Desiccated Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| 정식 스마일 | C(C(C(C(C(=O)C(=O)O)O)O)O)O |
|---|---|
| IUPAC Name | (3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid |
| InChIKey | VBUYCZFBVCCYFD-JJYYJPOSSA-N |
| INCHI | 1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/t2-,3-,4+/m1/s1 |
| 이성체 SMILES | C([C@H]([C@H]([C@@H](C(=O)C(=O)O)O)O)O)O |
| 대체 CAS | 20248-27-5,669-90-9,14984-38-4 (mono-hydrochloride salt) |
| MeSH 용어 | 2-ketogluconate;2-ketogluconate, (D)-isomer;2-ketogluconate, (D)-isomer, monopotassium salt;2-ketogluconate, monosodium salt;2-ketogluconic acid;2-oxogluconate |
| 분자량 | 194.14 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| 분류 | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Sugar acids and derivatives |
| Alternative Parents | Hexoses Medium-chain keto acids and derivatives Beta hydroxy acids and derivatives Beta-hydroxy ketones Alpha-keto acids and derivatives Acyloins Alpha-hydroxy ketones Secondary alcohols Polyols Monocarboxylic acids and derivatives Carboxylic acids Primary alcohols Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hexose monosaccharide - Medium-chain keto acid - Beta-hydroxy acid - Sugar acid - Acyloin - Alpha-keto acid - Beta-hydroxy ketone - Hydroxy acid - Keto acid - Monosaccharide - Alpha-hydroxy ketone - Ketone - Secondary alcohol - Carboxylic acid - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Polyol - Alcohol - Hydrocarbon derivative - Carbonyl group - Organic oxide - Primary alcohol - Aliphatic acyclic compound |
| 설명 | This compound belongs to the class of organic compounds known as sugar acids and derivatives. These are compounds containing a saccharide unit which bears a carboxylic acid group. |
| External Descriptors | Uronic acids |
| 감도 | Air sensitive;Light sensitive;Moisture sensitive |
|---|---|
| 분자량 | 194.140 g/mol |
| XLogP3 | -2.900 |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 5 |
| Exact Mass | 194.043 Da |
| Monoisotopic Mass | 194.043 Da |
| Topological Polar Surface Area | 135.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 201.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 3 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |