Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C,Argon charged Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| 정식 스마일 | C1=CC(=CC=C1N=[N+]=[N-])O |
|---|---|
| IUPAC Name | 4-azidophenol |
| InChIKey | ABSZNIJDTSIVHN-UHFFFAOYSA-N |
| INCHI | 1S/C6H5N3O/c7-9-8-5-1-3-6(10)4-2-5/h1-4,10H |
| 분자량 | 135.120 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| 분류 | Benzene and substituted derivatives |
| Subclass | Phenylazides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylazides |
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids Azo imides Azo compounds Organooxygen compounds Organic salts Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylazide - 1-hydroxy-2-unsubstituted benzenoid - Phenol - Azo imide - Azo compound - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Organic salt - Organooxygen compound - Organonitrogen compound - Organic cation - Aromatic homomonocyclic compound |
| 설명 | This compound belongs to the class of organic compounds known as phenylazides. These are compounds containing a phenylazide moiety, which consists of a linear azide substituent attached to a phenyl group. |
| External Descriptors | Not available |
| 분자량 | 135.120 g/mol |
|---|---|
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 135.043 Da |
| Monoisotopic Mass | 135.043 Da |
| Topological Polar Surface Area | 34.600 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 145.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |