Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| 정식 스마일 | COC1=CC2=C(C=C1)C3=C(CC4CCCCN4C3)C5=CC(=C(C=C52)OC)OC |
|---|---|
| IUPAC Name | (14aR)-2,3,6-trimethoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[9,10-b]quinolizine |
| InChIKey | RSHYSOGXGSUUIJ-OAHLLOKOSA-N |
| INCHI | 1S/C24H27NO3/c1-26-16-7-8-17-19(11-16)21-13-24(28-3)23(27-2)12-20(21)18-10-15-6-4-5-9-25(15)14-22(17)18/h7-8,11-13,15H,4-6,9-10,14H2,1-3H3/t15-/m1/s1 |
| 이성체 SMILES | COC1=CC2=C(C=C1)C3=C(C[C@H]4CCCCN4C3)C5=CC(=C(C=C52)OC)OC |
| 대체 CAS | 482-22-4 |
| PubChem CID | 92765 |
| NSC 번호 | 19912 |
| MeSH 용어 | cryptopleurine;cryptopleurine, (+-)-isomer |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| 분류 | Phenanthrenes and derivatives |
| Subclass | Phenanthroquinolizidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenanthroquinolizidines |
| Alternative Parents | Tetrahydroisoquinolines Quinolizidines Naphthalenes Anisoles Aralkylamines Alkyl aryl ethers Piperidines Trialkylamines Azacyclic compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Phenanthroquinolizidine - Naphthalene - Quinolizidine - Tetrahydroisoquinoline - Anisole - Alkyl aryl ether - Aralkylamine - Piperidine - Tertiary aliphatic amine - Tertiary amine - Ether - Azacycle - Organoheterocyclic compound - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Amine - Aromatic heteropolycyclic compound |
| 설명 | This compound belongs to the class of organic compounds known as phenanthroquinolizidines. These are aromatic polycyclic compounds containing the phenanthroindolizidine skeleton, which is structurally characterized by an indolizidine and a phenanthrene, where the quinolizidine is fused to the second benzene ring of a phenanthrene. |
| External Descriptors | aromatic ether - alkaloid - organic heteropentacyclic compound - alkaloid antibiotic |
| 분자량 | 377.500 g/mol |
|---|---|
| XLogP3 | 5.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 377.199 Da |
| Monoisotopic Mass | 377.199 Da |
| Topological Polar Surface Area | 30.900 Ų |
| Heavy Atom Count | 28 |
| Formal Charge | 0 |
| Complexity | 542.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |