Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| 정식 스마일 | C1CCC(C1)[Si](C2CCCC2)(O)O |
|---|---|
| IUPAC Name | dicyclopentyl(dihydroxy)silane |
| InChIKey | KKCJXDUBNUSNTR-UHFFFAOYSA-N |
| INCHI | 1S/C10H20O2Si/c11-13(12,9-5-1-2-6-9)10-7-3-4-8-10/h9-12H,1-8H2 |
| 이성체 SMILES | C1CCC(C1)[Si](C2CCCC2)(O)O |
| PubChem CID | 19904595 |
| 분자량 | 200.35 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| 분류 | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Silanols |
| Direct Parent | Dialkylsilanediols |
| Alternative Parents | Organoheterosilanes Organic metalloid salts Organic oxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Dialkylsilanediol - Organoheterosilane - Organic metalloid salt - Organic oxygen compound - Hydrocarbon derivative - Organic salt - Aliphatic homomonocyclic compound |
| 설명 | This compound belongs to the class of organic compounds known as dialkylsilanediols. These are organosilicon compounds with the general formula HO[Si](R)(R')OH where R and R' are alkyl groups. |
| External Descriptors | Not available |
| 분자량 | 200.350 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 200.123 Da |
| Monoisotopic Mass | 200.123 Da |
| Topological Polar Surface Area | 40.500 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 152.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |