Determine the necessary mass, volume, or concentration for preparing a solution.
analytical standard 분석 표준물질 for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships FedEx DG Service Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 528773080 |
|---|---|
| 정식 스마일 | C12(C3(C4(C5(C3(C(C1(C5(C2(C4(Cl)Cl)Cl)Cl)Cl)(Cl)Cl)Cl)Cl)Cl)Cl)Cl |
| IUPAC Name | 1,2,3,4,5,5,6,7,8,9,10,10-dodecachloropentacyclo[5.3.0.02,6.03,9.04,8]decane |
| InChIKey | GVYLCNUFSHDAAW-UHFFFAOYSA-N |
| INCHI | 1S/C10Cl12/c11-1-2(12)7(17)4(14)3(13,5(1,15)9(7,19)20)6(1,16)10(21,22)8(2,4)18 |
| 이성체 SMILES | C12(C3(C4(C5(C3(C(C1(C5(C2(C4(Cl)Cl)Cl)Cl)Cl)(Cl)Cl)Cl)Cl)Cl)Cl)Cl |
| WGK 독일 | 1 |
| UN 번호 | 2761 |
| 포장 그룹 | I |
| 분자량 | 545.54 |
| Beilstein | 5605269 |
| Reaxy-Rn | 2010845 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2010845&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| 분류 | Prenol lipids |
| Subclass | Monoterpenoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Monoterpenoids |
| Alternative Parents | Organochlorides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Norbornane monoterpenoid - Monoterpenoid - Hydrocarbon derivative - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Aliphatic homopolycyclic compound |
| 설명 | This compound belongs to the class of organic compounds known as monoterpenoids. These are compounds containing a chain of two isoprene units. |
| External Descriptors | Organochlorine pesticides - Organochlorine insecticides |
| 발화점(°F) | -17 °C |
|---|---|
| 발화점(°C) | -17°C |
| 분자량 | 545.500 g/mol |
| XLogP3 | 5.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 545.617 Da |
| Monoisotopic Mass | 539.626 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 567.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Rong Huang, Zhong Dong, Wanyi Zhang, Zhenggang Xue, Dongmei Deng, Wei Wang, Yuanyuan Li, Haibo He, Liqiang Luo. (2025) Cu−N4 Active Site Sensing Platform for Point-of-Care Colorimetric Detection of Environmental Organophosphorus Pesticide. ANALYTICA CHIMICA ACTA, [PMID:41330687] [10.1016/j.aca.2025.344856] |
| 2. Xiang Shen, Zheshan Duan, Xike Tian, Hongtao Zheng, Dongsheng Wang, Xubo Gao. (2025) The vertical distribution, sources and ecological risks of residual organochlorine pesticides in sediments of the North China's largest freshwater lake. SCIENCE OF THE TOTAL ENVIRONMENT, [PMID:41240894] [10.1016/j.scitotenv.2025.180881] |
Our grade selection guide covers purity, stabilizer status, and application suitability for all variants in our catalog.
View Analytical standard grade guide →