Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| 정식 스마일 | C(C(C(C(C(CBr)O)O)O)O)Br |
|---|---|
| IUPAC Name | (2R,3S,4R,5S)-1,6-dibromohexane-2,3,4,5-tetrol |
| InChIKey | VFKZTMPDYBFSTM-GUCUJZIJSA-N |
| INCHI | 1S/C6H12Br2O4/c7-1-3(9)5(11)6(12)4(10)2-8/h3-6,9-12H,1-2H2/t3-,4+,5+,6- |
| 이성체 SMILES | C([C@H]([C@@H]([C@@H]([C@H](CBr)O)O)O)O)Br |
| 대체 CAS | 10318-26-0 |
| PubChem CID | 5284380 |
| MeSH 용어 | Dibromodulcitol;Mitolactol;NSC 104800;NSC-104800;NSC104800 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| 분류 | Halohydrins |
| Subclass | Bromohydrins |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Bromohydrins |
| Alternative Parents | Secondary alcohols Polyols Organobromides Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Secondary alcohol - Bromohydrin - Polyol - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Organobromide - Alkyl halide - Alkyl bromide - Alcohol - Aliphatic acyclic compound |
| 설명 | This compound belongs to the class of organic compounds known as bromohydrins. These are alcohols substituted by a bromine atom at a saturated carbon atom otherwise bearing only hydrogen or hydrocarbyl groups. |
| External Descriptors | Not available |
| 분자량 | 307.960 g/mol |
|---|---|
| XLogP3 | -0.300 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 307.908 Da |
| Monoisotopic Mass | 305.91 Da |
| Topological Polar Surface Area | 80.900 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 110.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |