Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| 정식 스마일 | CC(C)(C)NCC(COC1=CN(C(=O)C2=CC=CC=C21)C)O |
|---|---|
| IUPAC Name | 4-[3-(tert-butylamino)-2-hydroxypropoxy]-2-methylisoquinolin-1-one |
| InChIKey | TWVUMMQUXMYOOH-UHFFFAOYSA-N |
| INCHI | 1S/C17H24N2O3/c1-17(2,3)18-9-12(20)11-22-15-10-19(4)16(21)14-8-6-5-7-13(14)15/h5-8,10,12,18,20H,9,11H2,1-4H3 |
| 이성체 SMILES | CC(C)(C)NCC(COC1=CN(C(=O)C2=CC=CC=C21)C)O |
| 대체 CAS | 85136-71-6 |
| PubChem CID | 5474 |
| MeSH 용어 | 4-(3(tert-butylamino)-2-hydroxypropoxy)-N-methylisocarbostyril;N 696;N-696;tilisolol |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| 분류 | Isoquinolines and derivatives |
| Subclass | Isoquinolones and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Isoquinolones and derivatives |
| Alternative Parents | Pyridinones Alkyl aryl ethers Benzenoids Heteroaromatic compounds Secondary alcohols Lactams 1,2-aminoalcohols Dialkylamines Azacyclic compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Isoquinolone - Alkyl aryl ether - Pyridinone - Pyridine - Benzenoid - Heteroaromatic compound - 1,2-aminoalcohol - Lactam - Secondary alcohol - Secondary aliphatic amine - Ether - Azacycle - Secondary amine - Organonitrogen compound - Organic oxide - Organopnictogen compound - Alcohol - Organic nitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxygen compound - Amine - Aromatic heteropolycyclic compound |
| 설명 | This compound belongs to the class of organic compounds known as isoquinolones and derivatives. These are aromatic polycyclic compounds containing a ketone bearing isoquinoline moiety. |
| External Descriptors | Not available |
| 분자량 | 304.400 g/mol |
|---|---|
| XLogP3 | 1.100 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 6 |
| Exact Mass | 304.179 Da |
| Monoisotopic Mass | 304.179 Da |
| Topological Polar Surface Area | 61.800 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 428.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |