Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 4 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| 정식 스마일 | C1=CC=C(C(=C1)C2=NC=NN2)N3C=CN=C3 |
|---|---|
| IUPAC Name | 5-(2-imidazol-1-ylphenyl)-1H-1,2,4-triazole |
| InChIKey | MEOQWPMLKZKWFI-UHFFFAOYSA-N |
| INCHI | 1S/C11H9N5/c1-2-4-10(16-6-5-12-8-16)9(3-1)11-13-7-14-15-11/h1-8H,(H,13,14,15) |
| 이성체 SMILES | C1=CC=C(C(=C1)C2=NC=NN2)N3C=CN=C3 |
| PubChem CID | 2764127 |
| 분자량 | 211.22 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| 분류 | Azoles |
| Subclass | Imidazoles |
| Intermediate Tree Nodes | Substituted imidazoles |
| Direct Parent | Phenylimidazoles |
| Alternative Parents | Phenyl-1,2,4-triazoles N-substituted imidazoles Benzene and substituted derivatives Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenyl-1,2,4-triazole - Phenyltriazole - 1-phenylimidazole - Benzenoid - N-substituted imidazole - Monocyclic benzene moiety - Heteroaromatic compound - 1,2,4-triazole - Triazole - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteromonocyclic compound |
| 설명 | This compound belongs to the class of organic compounds known as phenylimidazoles. These are polycyclic aromatic compounds containing a benzene ring linked to an imidazole ring through a CC or CN bond. |
| External Descriptors | Not available |
| 분자량 | 211.220 g/mol |
|---|---|
| XLogP3 | 1.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 211.086 Da |
| Monoisotopic Mass | 211.086 Da |
| Topological Polar Surface Area | 59.400 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 234.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Qiqiao Liu, Wei Chen, Ying Wang, Zihan Ye, Sheng Liu, Jiang Yu, Guangyi Liu. (2025) New insights into the structure-activity relationship of the N containing heterocyclic activators for the lime depressed molybdenite flotation. MINERALS ENGINEERING, [PMID:] [10.1016/j.mineng.2025.109605] |
| 2. Zongwu Wei, Sefeng Qin, Jiayi Wang, Chuncan Yang, Huafa Liang, Kungang Chai, Zhiqiang Lin, Fang Shen. (2025) Efficient adsorptive separation of Pb(Ⅱ) via Zn-triazole metal-organic framework. MICROPOROUS AND MESOPOROUS MATERIALS, [PMID:] [10.1016/j.micromeso.2025.113780] |
| 3. Abbas Touqeer, Mubeen Muhammad, Razzaq Abdul, Javed Umair, Raza Muneeb, Tabish Mohammad, Alotaibi Khalid M., Yasin Ghulam, Li Hui. (2025) RustNet: an automated approach for rust detection and quantification in steel structures using feature encoding and multilayer attention networks. Archives of Civil and Mechanical Engineering, 25 (5): (1-25). [PMID:] [10.1007/s43452-025-01312-5] |
| 4. Haiqing Liu, Muhammad Jawad, Jingmao Zhao, Baomin Fan, Mohammad Tabish, Muhammad Mubeen, Mubashar Mahmood, Jingbao Wang. (2025) Filiform Corrosion Inhibition of Zn–Al–Mg-Coated Steel by Ti–Zr Conversion Coating: Crucial Role of Benzotriazole-5-Carboxylic Acid. LANGMUIR, [PMID:40613110] [10.1021/acs.langmuir.5c00791] |