Determine the necessary mass, volume, or concentration for preparing a solution.
≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1=CC2=C(C=C1O)C(=O)C3=C2C=CC(=C3)O |
|---|---|
| IUPAC Name | 2,7-dihydroxyfluoren-9-one |
| InChIKey | CWHPQXRTQSNTRR-UHFFFAOYSA-N |
| INCHI | 1S/C13H8O3/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16)11(9)5-7/h1-6,14-15H |
| Isomeric SMILES | C1=CC2=C(C=C1O)C(=O)C3=C2C=CC(=C3)O |
| Molecular Weight | 212.20 |
| Reaxy-Rn | 1960042 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1960042&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Fluorenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorenes |
| Alternative Parents | Aryl ketones 1-hydroxy-2-unsubstituted benzenoids Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Fluorene - Aryl ketone - 1-hydroxy-2-unsubstituted benzenoid - Phenol - Ketone - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as fluorenes. These are compounds containing a fluorene moiety, which consists of two benzene rings connected through either a cyclopentane, cyclopentene, or cyclopenta-1,3-diene. |
| External Descriptors | Not available |
| Flash Point(°C) | 236.7ºC |
|---|---|
| Boil Point(°C) | 444.5ºC at 760 mmHg |
| Melt Point(°C) | 329 °C |
| Molecular Weight | 212.200 g/mol |
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 212.047 Da |
| Monoisotopic Mass | 212.047 Da |
| Topological Polar Surface Area | 57.500 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 274.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Wang Hui, Wang Jun, Feng Tian-tian, Ramdani Noureddine, Li Yue, Xu Xiao-dong, Liu Wen-bin. (2014) Synthesis, curing behavior, and thermal properties of fluorene-based benzoxazine-endcapped copoly(ether ketone ketone)s. JOURNAL OF THERMAL ANALYSIS AND CALORIMETRY, 119 (3): (1913-1921). [PMID:] [10.1007/s10973-014-4294-1] |
| 2. Zichun Ding, Jianjian Jiao, Yuhang Wang, Runze Liu, Qing Wang, Jianing Guo, Siying Wang, Lishuai Zong, Xigao Jian, Jinyan Wang. (2025) Synergistic improvement of toughness and thermal properties of phthalonitrile resin based on the multiple curing mechanism of amino-carborane. COMPOSITES PART A-APPLIED SCIENCE AND MANUFACTURING, [PMID:] [10.1016/j.compositesa.2025.108903] |