Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature,Argon charged,Desiccated Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 5 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
(1S)-(+)-3-Carene is a monoterpene.
| Pubchem Sid | 504758793 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504758793 |
| Kanonisches Lächeln | CC1=CCC2C(C1)C2(C)C |
| IUPAC Name | (1S,6R)-3,7,7-trimethylbicyclo[4.1.0]hept-3-ene |
| InChIKey | BQOFWKZOCNGFEC-BDAKNGLRSA-N |
| INCHI | 1S/C10H16/c1-7-4-5-8-9(6-7)10(8,2)3/h4,8-9H,5-6H2,1-3H3/t8-,9+/m1/s1 |
| Isomere SMILES | CC1=CC[C@@H]2[C@H](C1)C2(C)C |
| Molekulargewicht | 136.23 |
| Reaxy-Rn | 8141645 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8141645&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Klasse | Prenol lipids |
| Subclass | Monoterpenoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Bicyclic monoterpenoids |
| Alternative Parents | Polycyclic hydrocarbons Branched unsaturated hydrocarbons Cyclic olefins Unsaturated aliphatic hydrocarbons |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Carane monoterpenoid - Bicyclic monoterpenoid - Branched unsaturated hydrocarbon - Polycyclic hydrocarbon - Cyclic olefin - Unsaturated aliphatic hydrocarbon - Unsaturated hydrocarbon - Olefin - Hydrocarbon - Aliphatic homopolycyclic compound |
| Beschreibung | This compound belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other. |
| External Descriptors | Bicyclic monoterpenoids |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Datum | Artikel |
|---|---|---|---|
| Certificate of Analysis | Dec 10, 2025 | C303816 | |
| Certificate of Analysis | Dec 10, 2025 | C303816 | |
| Certificate of Analysis | May 06, 2025 | C303816 | |
| Certificate of Analysis | May 06, 2025 | C303816 | |
| Certificate of Analysis | May 23, 2024 | C303816 | |
| Certificate of Analysis | May 23, 2024 | C303816 |
| Löslichkeit | Soluble in ethanol, acetone and benzene |
|---|---|
| Empfindlichkeit | Air sensitive |
| Brechungsindex | 1.47 |
| Spezifische Drehung [α] | 14.5° (neat) |
| Flammpunkt (°C) | 46°C(lit.) |
| Siedepunkt (°C) | 170℃ |
| Molekulargewicht | 136.230 g/mol |
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 136.125 Da |
| Monoisotopic Mass | 136.125 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 186.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Liu Bin, Chen Hui. (2023) Disruption of carboxylesterase DaEST3 reduces tolerance to host allelochemicals in Dendroctonus armandi. Arthropod-Plant Interactions, 17 (5): (673-685). [PMID:] [10.1007/s11829-023-09990-9] |
| 2. Bin Liu, Hui Chen. (2022) Identification and Functional Characterization of the Transcription Factors AhR/ARNT in Dendroctonus armandi. Cells, 11 (23): (3856). [PMID:36497113] [10.3390/cells11233856] |
| 3. Bin Liu, Danyang Fu, Hang Ning, Ming Tang, Hui Chen. (2022) Knockdown of CYP6CR2 and CYP6DE5 reduces tolerance to host plant allelochemicals in the Chinese white pine beetle Dendroctonus armandi. PESTICIDE BIOCHEMISTRY AND PHYSIOLOGY, [PMID:36127042] [10.1016/j.pestbp.2022.105180] |
| 4. Lulu Dai, Haiming Gao, Jiaqi Ye, Danyang Fu, Yaya Sun, Hui Chen. (2018) Isolation of CarE genes from the Chinese white pine beetle Dendroctonus armandi (Curculionidae: Scolytinae) and their response to host chemical defense. PEST MANAGEMENT SCIENCE, 75 (4): (986-997). [PMID:30204286] [10.1002/ps.5205] |
| 5. Honglei He, Feng Lan, Bei Zhang, Tianzi Gu, Jianyang Bai, Qing-He Zhang, Jacob D. Wickham, Longwa Zhang. (2026) Two Minus-C odorant-binding proteins (OBPs) involved in the perception of kairomone (+)-3-carene in Dendroctonus valens. Insect Science, [PMID:42473719] [10.1111/1744-7917.70321] |