Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
4′-Piperidinoacetophenone undergoes Claisen-Schmidt condensation with substituted benzaldehydes using NaOH-Al2O3 by microwave irradiation to give chalcones. It has antimycobacterial activity.
4′-Piperidinoacetophenone was used as internal standard in the determination of pethidine, a narcotic analgesic drug in body fluids by gas chromatography-tandem mass spectrometry. Pharmacological activity: Selective antimycobacterial activity Bronchodilator compound Modulation of flagellar motility in Chlamydomonas
| Kanonisches Lächeln | CC(=O)C1=CC=C(C=C1)N2CCCCC2 |
|---|---|
| IUPAC Name | 1-(4-piperidin-1-ylphenyl)ethanone |
| InChIKey | JCMZZYSPSGHBNM-UHFFFAOYSA-N |
| INCHI | 1S/C13H17NO/c1-11(15)12-5-7-13(8-6-12)14-9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
| Isomere SMILES | CC(=O)C1=CC=C(C=C1)N2CCCCC2 |
| WGK Deutschland | 3 |
| PubChem CID | 82561 |
| Molekulargewicht | 203.28 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Klasse | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Aryl ketones - Phenylketones |
| Direct Parent | Alkyl-phenylketones |
| Alternative Parents | Phenylpiperidines Acetophenones Dialkylarylamines Benzoyl derivatives Aryl alkyl ketones Aniline and substituted anilines Azacyclic compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkyl-phenylketone - Phenylpiperidine - Acetophenone - Benzoyl - Aniline or substituted anilines - Dialkylarylamine - Tertiary aliphatic/aromatic amine - Aryl alkyl ketone - Monocyclic benzene moiety - Piperidine - Benzenoid - Tertiary amine - Azacycle - Organoheterocyclic compound - Hydrocarbon derivative - Organonitrogen compound - Organic oxide - Organopnictogen compound - Organic nitrogen compound - Amine - Aromatic heteromonocyclic compound |
| Beschreibung | This compound belongs to the class of organic compounds known as alkyl-phenylketones. These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group. |
| External Descriptors | Not available |
| Schmelzpunkt (°C) | 85-87°C |
|---|---|
| Molekulargewicht | 203.280 g/mol |
| XLogP3 | 3.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 203.131 Da |
| Monoisotopic Mass | 203.131 Da |
| Topological Polar Surface Area | 20.300 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 213.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |