Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Description
This novel material is capable of self-assembly onto gold surfaces. The fluorene group is a precursor for the synthesis of luminophore materials that have longer lifespans and more efficient luminescence.
| Kanonisches Lächeln | C1=CC=C2C(=C1)C(C3=CC=CC=C32)S |
|---|---|
| IUPAC Name | 9H-fluorene-9-thiol |
| InChIKey | GNURAXCIBMZJOG-UHFFFAOYSA-N |
| INCHI | 1S/C13H10S/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13-14H |
| Isomere SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)S |
| UN-Nummer | 3077 |
| Molekulargewicht | 198.28 |
| Reaxy-Rn | 2363688 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2363688&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Klasse | Fluorenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorenes |
| Alternative Parents | Alkylthiols Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Fluorene - Alkylthiol - Hydrocarbon derivative - Organosulfur compound - Aromatic homopolycyclic compound |
| Beschreibung | This compound belongs to the class of organic compounds known as fluorenes. These are compounds containing a fluorene moiety, which consists of two benzene rings connected through either a cyclopentane, cyclopentene, or cyclopenta-1,3-diene. |
| External Descriptors | Not available |
| Flammpunkt (°F) | Not applicable |
|---|---|
| Flammpunkt (°C) | Not applicable |
| Schmelzpunkt (°C) | 103-107℃ |
| Molekulargewicht | 198.290 g/mol |
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 198.05 Da |
| Monoisotopic Mass | 198.05 Da |
| Topological Polar Surface Area | 1.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 191.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |