35% -39% (calculated as BHMTPMPA) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Kanonisches Lächeln | C(CCCN(CP(=O)(O)O)CP(=O)(O)O)CCN(CCCCCCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O |
|---|---|
| IUPAC Name | [bis[6-[bis(phosphonomethyl)amino]hexyl]amino]methylphosphonic acid |
| InChIKey | YWMWZKYVGNWJPU-UHFFFAOYSA-N |
| INCHI | 1S/C17H44N3O15P5/c21-36(22,23)13-18(9-5-1-3-7-11-19(14-37(24,25)26)15-38(27,28)29)10-6-2-4-8-12-20(16-39(30,31)32)17-40(33,34)35/h1-17H2,(H2,21,22,23)(H2,24,25,26)(H2,27,28,29)(H2,30,31,32)(H2,33,34,35) |
| Isomere SMILES | C(CCCN(CP(=O)(O)O)CP(=O)(O)O)CCN(CCCCCCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O |
| Alternative CAS-Nummer | 34690-00-1,35657-77-3 |
| PubChem CID | 118717 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Klasse | Organic phosphonic acids and derivatives |
| Subclass | Organic phosphonic acids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organic phosphonic acids |
| Alternative Parents | Organopnictogen compounds Organophosphorus compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Organophosphonic acid - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organophosphorus compound - Organonitrogen compound - Aliphatic acyclic compound |
| Beschreibung | This compound belongs to the class of organic compounds known as organic phosphonic acids. These are organic compounds containing phosphonic acid. |
| External Descriptors | Not available |
| Molekulargewicht | 685.400 g/mol |
|---|---|
| XLogP3 | -12.300 |
| Hydrogen Bond Donor Count | 10 |
| Hydrogen Bond Acceptor Count | 18 |
| Rotatable Bond Count | 24 |
| Exact Mass | 685.146 Da |
| Monoisotopic Mass | 685.146 Da |
| Topological Polar Surface Area | 297.000 Ų |
| Heavy Atom Count | 40 |
| Formal Charge | 0 |
| Complexity | 846.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
