Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488185382 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488185382 |
| Kanonisches Lächeln | CCCCCC[Si](CCCCCC)(CCCCCC)Cl |
| IUPAC Name | chloro(trihexyl)silane |
| InChIKey | WZQSBCHNVPAYOC-UHFFFAOYSA-N |
| INCHI | 1S/C18H39ClSi/c1-4-7-10-13-16-20(19,17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3 |
| Isomere SMILES | CCCCCC[Si](CCCCCC)(CCCCCC)Cl |
| WGK Deutschland | 1 |
| Molekulargewicht | 319.04 |
| Reaxy-Rn | 1763434 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1763434&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Klasse | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Organoheterosilanes - Trialkylheterosilanes |
| Direct Parent | Trialkylchlorosilanes |
| Alternative Parents | Silyl monohalides Organochlorosilanes Organic metalloid salts Alkylhalosilanes Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trialkylchlorosilane - Silyl monohalide - Organochlorosilane - Organic metalloid salt - Alkylhalosilane - Hydrocarbon derivative - Organic salt - Aliphatic acyclic compound |
| Beschreibung | This compound belongs to the class of organic compounds known as trialkylchlorosilanes. These are organoheterosilanes, bearing a silicon atom linked to three alkyl groups and one chlorine atom. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Datum | Artikel |
|---|---|---|---|
| Certificate of Analysis | Mar 17, 2026 | C169920 | |
| Certificate of Analysis | Nov 03, 2022 | C169920 | |
| Certificate of Analysis | Nov 03, 2022 | C169920 | |
| Certificate of Analysis | Nov 03, 2022 | C169920 |
| Empfindlichkeit | Moisture sensitive |
|---|---|
| Brechungsindex | n20/D 1.454 |
| Flammpunkt (°F) | 235.4 °F |
| Flammpunkt (°C) | 113 °C |
| Siedepunkt (°C) | 153.5-154 °C/5 mmHg |
| Molekulargewicht | 319.000 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 15 |
| Exact Mass | 318.251 Da |
| Monoisotopic Mass | 318.251 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 163.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |