≥99.5 atom% D for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Room temperature,Desiccated Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1CCCCC1 |
|---|---|
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuteriocyclohexane |
| InChIKey | XDTMQSROBMDMFD-LBTWDOQPSA-N |
| INCHI | 1S/C6H12/c1-2-4-6-5-3-1/h1-6H2/i1D2,2D2,3D2,4D2,5D2,6D2 |
| Isomeric SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
| Alternate CAS | 110-82-7（unlabelled） |
| Molecular Weight | 96.23 |
| Reaxy-Rn | 1900225 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1900225&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Hydrocarbons |
| Class | Saturated hydrocarbons |
| Subclass | Cycloalkanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cycloalkanes |
| Alternative Parents | Not available |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cycloalkane - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cycloalkanes. These are saturated monocyclic hydrocarbons (with or without side chains). |
| External Descriptors | Not available |
| Sensitivity | Hygroscopic；Light sensitive |
|---|---|
| Boil Point(°C) | 80.7 °C |
| Melt Point(°C) | 6.5°C |
| Molecular Weight | 96.230 g/mol |
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 96.1692 Da |
| Monoisotopic Mass | 96.1692 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 6 |
| Formal Charge | 0 |
| Complexity | 15.500 |
| Isotope Atom Count | 12 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
E2614186