Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C(C1C(C(C(C(O1)OP(=O)(O)O)O)O)O)O |
|---|---|
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate |
| InChIKey | HXXFSFRBOHSIMQ-VFUOTHLCSA-N |
| INCHI | 1S/C6H13O9P/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5-,6-/m1/s1 |
| Isomeric SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OP(=O)(O)O)O)O)O)O |
| Alternate CAS | 59-56-3,56401-20-8,6997-09-7 (mono-calcium salt) |
| MeSH Entry Terms | alpha-glucose-1-phosphate;beta-glucose-1-phosphate;glucose-1-phosphate;glucose-1-phosphate, (beta-D-Glc)-isomer;glucose-1-phosphate, (D-Glc)-isomer;glucose-1-phosphate, dipotassium salt;glucose-1-phosphate, dipotassium salt, (D-Glc)-isomer;glucose-1-phosp |
| Molecular Weight | 260.14 |
| Reaxy-Rn | 25246047 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=25246047&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Monosaccharides |
| Direct Parent | Monosaccharide phosphates |
| Alternative Parents | Hexoses Monoalkyl phosphates Oxanes Secondary alcohols Polyols Oxacyclic compounds Primary alcohols Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Hexose monosaccharide - Monosaccharide phosphate - Monoalkyl phosphate - Organic phosphoric acid derivative - Oxane - Alkyl phosphate - Phosphoric acid ester - Secondary alcohol - Oxacycle - Organoheterocyclic compound - Polyol - Alcohol - Hydrocarbon derivative - Primary alcohol - Organic oxide - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as monosaccharide phosphates. These are monosaccharides comprising a phosphated group linked to the carbohydrate unit. |
| External Descriptors | D-glucopyranose 1-phosphate |
| Sensitivity | Moisture sensitive |
|---|---|
| Molecular Weight | 260.140 g/mol |
| XLogP3 | -3.800 |
| Hydrogen Bond Donor Count | 6 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 3 |
| Exact Mass | 260.03 Da |
| Monoisotopic Mass | 260.03 Da |
| Topological Polar Surface Area | 157.000 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 277.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 5 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Wei Gao, Ru Yang, Mengli Li, Ming Miao, Tao Zhang. (2025) High-performance biocatalyst Nicotiana attenuata α-glucan phosphorylase facilitates the robust synthesis of amylose from cellobiose. INTERNATIONAL JOURNAL OF BIOLOGICAL MACROMOLECULES, [PMID:40618824] [10.1016/j.ijbiomac.2025.145791] |
| 2. Wei Gao, Ru Yang, Mengli Li, Ming Miao, Tao Zhang. (2025) A novel thermophilic α-glucan phosphorylase enables molecular weight-tunable amylose biosynthesis from cellobiose via a dual-enzyme cascade system. Food Bioscience, [PMID:] [10.1016/j.fbio.2025.107772] |