≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 528769680 |
|---|---|
| Kanonisches Lächeln | C(=C(C(=O)O)Br)(C(=O)O)Br |
| IUPAC Name | (Z)-2,3-dibromobut-2-enedioic acid |
| InChIKey | PMNMPRXRQYSFRP-UPHRSURJSA-N |
| INCHI | 1S/C4H2Br2O4/c5-1(3(7)8)2(6)4(9)10/h(H,7,8)(H,9,10)/b2-1- |
| Isomere SMILES | C(=C(\C(=O)O)/Br)(\C(=O)O)/Br |
| Molekulargewicht | 273.86 |
| Beilstein | 1724799 |
| Reaxy-Rn | 28285616 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=28285616&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Klasse | Fatty Acyls |
| Subclass | Fatty acids and conjugates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Halogenated fatty acids |
| Alternative Parents | Unsaturated fatty acids Dicarboxylic acids and derivatives Vinylogous halides Alpha-halocarboxylic acids Vinyl bromides Carboxylic acids Bromoalkenes Organobromides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Halogenated fatty acid - Dicarboxylic acid or derivatives - Unsaturated fatty acid - Alpha-halocarboxylic acid - Alpha-halocarboxylic acid or derivatives - Vinylogous halide - Carboxylic acid derivative - Carboxylic acid - Bromoalkene - Haloalkene - Vinyl bromide - Vinyl halide - Organic oxide - Hydrocarbon derivative - Organohalogen compound - Organobromide - Organooxygen compound - Carbonyl group - Organic oxygen compound - Aliphatic acyclic compound |
| Beschreibung | This compound belongs to the class of organic compounds known as halogenated fatty acids. These are fatty acids with a chain that carries a halogen atom (Cl,F,I,Br). |
| External Descriptors | Not available |
| Flammpunkt (°F) | Not applicable |
|---|---|
| Flammpunkt (°C) | Not applicable |
| Schmelzpunkt (°C) | ~125℃ (dec.) (lit.) |
| Molekulargewicht | 273.860 g/mol |
| XLogP3 | 1.400 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 273.83 Da |
| Monoisotopic Mass | 271.832 Da |
| Topological Polar Surface Area | 74.600 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 185.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |
L2516416