Determine the necessary mass, volume, or concentration for preparing a solution.
≥96%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 508812172 |
|---|---|
| Kanonisches Lächeln | CCCCCCCC[Si](CCCCCCCC)(Cl)Cl |
| IUPAC Name | dichloro(dioctyl)silane |
| InChIKey | CVAGYCLEIYGJQT-UHFFFAOYSA-N |
| INCHI | 1S/C16H34Cl2Si/c1-3-5-7-9-11-13-15-19(17,18)16-14-12-10-8-6-4-2/h3-16H2,1-2H3 |
| Isomere SMILES | CCCCCCCC[Si](CCCCCCCC)(Cl)Cl |
| Molekulargewicht | 325.43 |
| Reaxy-Rn | 1765405 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1765405&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Klasse | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Organoheterosilanes |
| Direct Parent | Organochlorosilanes |
| Alternative Parents | Organic metalloid salts Alkylhalosilanes Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Organochlorosilane - Organic metalloid salt - Alkylhalosilane - Hydrocarbon derivative - Organic salt - Aliphatic acyclic compound |
| Beschreibung | This compound belongs to the class of organic compounds known as organochlorosilanes. These are organosilicon compounds where the tetravalent silicon atom is linked to one or more chlorine atoms. |
| External Descriptors | Not available |
| Löslichkeit | Sparingly Soluble (8.8E-6 g/L) at 25°C |
|---|---|
| Empfindlichkeit | Moisture sensitive. |
| Brechungsindex | 1.46 |
| Flammpunkt (°C) | 110°C |
| Siedepunkt (°C) | 150°C/5mmHg(lit.) |
| Molekulargewicht | 325.400 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 14 |
| Exact Mass | 324.181 Da |
| Monoisotopic Mass | 324.181 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 166.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |