Determine the necessary mass, volume, or concentration for preparing a solution.
≥97%(T) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504755057 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504755057 |
| Canonical Smiles | CCCCCCCC[N+](C)(C)CCCCCCCC.[Br-] |
| IUPAC Name | dimethyl(dioctyl)azanium;bromide |
| InChIKey | APTVNWGLSRAOFJ-UHFFFAOYSA-M |
| INCHI | 1S/C18H40N.BrH/c1-5-7-9-11-13-15-17-19(3,4)18-16-14-12-10-8-6-2;/h5-18H2,1-4H3;1H/q+1;/p-1 |
| Isomeric SMILES | CCCCCCCC[N+](C)(C)CCCCCCCC.[Br-] |
| Molecular Weight | 350.43 |
| Reaxy-Rn | 5647963 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5647963&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Quaternary ammonium salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tetraalkylammonium salts |
| Alternative Parents | Organopnictogen compounds Organic bromide salts Hydrocarbon derivatives Amines |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tetraalkylammonium salt - Organopnictogen compound - Hydrocarbon derivative - Organic bromide salt - Organic salt - Amine - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as tetraalkylammonium salts. These are organonitrogen compounds containing a quaternary ammonium substituted with four alkyl chains. |
| External Descriptors | Not available |
| Sensitivity | Hygroscopic |
|---|---|
| Molecular Weight | 350.400 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 14 |
| Exact Mass | 349.234 Da |
| Monoisotopic Mass | 349.234 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 157.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Zilu Li, Zehuan Li, Yuxia Gao, Chenhui Zhang, Kefei Zhao, Yongfei Guo, Zhenping Bao, Tianyue Wu, Xiangdong Li, Fengpei Du. (2021) Assemblies disaggregation and diffusion dictated droplet impact and wetting behaviors on hydrophobic surface. JOURNAL OF MOLECULAR LIQUIDS, [PMID:] [10.1016/j.molliq.2021.116826] |
| 2. Bing Xiang, Kefeng Fang, Runci Song, Xinyi Chen, Kaihui Cui, Guoqing Zeng, Jie Chen, Xin Feng, Chao Yang. (2025) Impact Dynamics of Surfactant-Laden Droplets: Hydrophobic Chain Lengths Effects. INDUSTRIAL & ENGINEERING CHEMISTRY RESEARCH, [PMID:] [10.1021/acs.iecr.5c00717] |